From ba787a7ec0b15b7a3ec96b8b95e52f8d03647e02 Mon Sep 17 00:00:00 2001 From: Rui Chen Date: Sun, 29 Sep 2019 21:17:11 -0400 Subject: [PATCH 1/4] Upgrade to go v1.13.1 --- Dockerfile.dapper | 3 +-- Dockerfile.sonobuoy.dapper | 2 +- go.mod | 2 +- 3 files changed, 3 insertions(+), 4 deletions(-) diff --git a/Dockerfile.dapper b/Dockerfile.dapper index 87c747935a..35e79d1913 100644 --- a/Dockerfile.dapper +++ b/Dockerfile.dapper @@ -1,4 +1,4 @@ -FROM golang:1.12.9-alpine3.10 +FROM golang:1.13.1-alpine3.10 RUN apk -U --no-cache add bash git gcc musl-dev docker vim less file curl wget ca-certificates jq linux-headers zlib-dev tar zip squashfs-tools npm coreutils \ python3 py3-pip python3-dev openssl-dev libffi-dev libseccomp libseccomp-dev make @@ -29,4 +29,3 @@ WORKDIR ${DAPPER_SOURCE} ENTRYPOINT ["./scripts/entry.sh"] CMD ["ci"] - diff --git a/Dockerfile.sonobuoy.dapper b/Dockerfile.sonobuoy.dapper index 9935627e6a..6102159925 100644 --- a/Dockerfile.sonobuoy.dapper +++ b/Dockerfile.sonobuoy.dapper @@ -1,4 +1,4 @@ -FROM golang:1.12.9-alpine3.10 +FROM golang:1.13.1-alpine3.10 RUN apk -U --no-cache add bash git gcc musl-dev docker curl jq coreutils RUN go get -d github.com/heptio/sonobuoy && \ diff --git a/go.mod b/go.mod index e7c197b1d7..b316ce7af2 100644 --- a/go.mod +++ b/go.mod @@ -1,6 +1,6 @@ module github.com/rancher/k3s -go 1.12 +go 1.13 replace ( github.com/containerd/btrfs => github.com/containerd/btrfs v0.0.0-20181101203652-af5082808c83 From 3afecdbf4ecd430dd9734864d3bcca47de0f608f Mon Sep 17 00:00:00 2001 From: Rui Chen Date: Sun, 29 Sep 2019 21:35:37 -0400 Subject: [PATCH 2/4] `go mod tidy` with GOPROXY --- go.mod | 10 +++++++++- go.sum | 8 ++++++++ 2 files changed, 17 insertions(+), 1 deletion(-) diff --git a/go.mod b/go.mod index b316ce7af2..505c302dc0 100644 --- a/go.mod +++ b/go.mod @@ -16,6 +16,13 @@ replace ( github.com/coreos/go-systemd => github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7 github.com/docker/distribution => github.com/docker/distribution v0.0.0-20190205005809-0d3efadf0154 github.com/docker/libnetwork => github.com/docker/libnetwork v0.8.0-dev.2.0.20190624125649-f0e46a78ea34 + github.com/go-critic/go-critic => github.com/go-critic/go-critic v0.3.5-0.20190526074819-1df300866540 + github.com/golangci/errcheck => github.com/golangci/errcheck v0.0.0-20181223084120-ef45e06d44b6 + github.com/golangci/go-tools => github.com/golangci/go-tools v0.0.0-20190318060251-af6baa5dc196 + github.com/golangci/gofmt => github.com/golangci/gofmt v0.0.0-20181222123516-0b8337e80d98 + github.com/golangci/gosec => github.com/golangci/gosec v0.0.0-20190211064107-66fb7fc33547 + github.com/golangci/ineffassign => github.com/golangci/ineffassign v0.0.0-20190609212857-42439a7714cc + github.com/golangci/lint-1 => github.com/golangci/lint-1 v0.0.0-20190420132249-ee948d087217 github.com/kubernetes-sigs/cri-tools => github.com/rancher/cri-tools v1.16.0-k3s.1 github.com/matryer/moq => github.com/rancher/moq v0.0.0-20190404221404-ee5226d43009 github.com/opencontainers/runtime-spec => github.com/opencontainers/runtime-spec v0.0.0-20180911193056-5684b8af48c1 @@ -50,7 +57,8 @@ replace ( k8s.io/sample-apiserver => github.com/rancher/kubernetes/staging/src/k8s.io/sample-apiserver v1.16.0-k3s.1 k8s.io/sample-cli-plugin => github.com/rancher/kubernetes/staging/src/k8s.io/sample-cli-plugin v1.16.0-k3s.1 k8s.io/sample-controller => github.com/rancher/kubernetes/staging/src/k8s.io/sample-controller v1.16.0-k3s.1 - + mvdan.cc/unparam => mvdan.cc/unparam v0.0.0-20190209190245-fbb59629db34 +// github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options => github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options 82c7525d98c8 ) require ( diff --git a/go.sum b/go.sum index 091fcf4ba6..c9e1598012 100644 --- a/go.sum +++ b/go.sum @@ -203,6 +203,7 @@ github.com/go-bindata/go-bindata v3.1.1+incompatible/go.mod h1:xK8Dsgwmeed+BBsSy github.com/go-bindata/go-bindata v3.1.2+incompatible h1:5vjJMVhowQdPzjE1LdxyFF7YFTXg5IgGVW4gBr5IbvE= github.com/go-bindata/go-bindata v3.1.2+incompatible/go.mod h1:xK8Dsgwmeed+BBsSy2XTopBn/8uK2HWuGSnA11C3Joo= github.com/go-critic/go-critic v0.0.0-20181204210945-1df300866540/go.mod h1:+sE8vrLDS2M0pZkBk0wy6+nLdKexVDrl/jBqQOTDThA= +github.com/go-critic/go-critic v0.3.5-0.20190526074819-1df300866540/go.mod h1:+sE8vrLDS2M0pZkBk0wy6+nLdKexVDrl/jBqQOTDThA= github.com/go-lintpack/lintpack v0.5.2/go.mod h1:NwZuYi2nUHho8XEIZ6SIxihrnPoqBTDqfpXvXAN0sXM= github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= github.com/go-ole/go-ole v1.2.1/go.mod h1:7FAglXiTm7HKlQRDeOQ6ZNUHidzCWXuZWq/1dTyBNF8= @@ -296,15 +297,21 @@ github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5y github.com/golangci/check v0.0.0-20180506172741-cfe4005ccda2/go.mod h1:k9Qvh+8juN+UKMCS/3jFtGICgW8O96FVaZsaxdzDkR4= github.com/golangci/dupl v0.0.0-20180902072040-3e9179ac440a/go.mod h1:ryS0uhF+x9jgbj/N71xsEqODy9BN81/GonCZiOzirOk= github.com/golangci/errcheck v0.0.0-20181003203344-ef45e06d44b6/go.mod h1:DbHgvLiFKX1Sh2T1w8Q/h4NAI8MHIpzCdnBUDTXU3I0= +github.com/golangci/errcheck v0.0.0-20181223084120-ef45e06d44b6/go.mod h1:DbHgvLiFKX1Sh2T1w8Q/h4NAI8MHIpzCdnBUDTXU3I0= github.com/golangci/go-misc v0.0.0-20180628070357-927a3d87b613/go.mod h1:SyvUF2NxV+sN8upjjeVYr5W7tyxaT1JVtvhKhOn2ii8= github.com/golangci/go-tools v0.0.0-20180109140146-af6baa5dc196/go.mod h1:unzUULGw35sjyOYjUt0jMTXqHlZPpPc6e+xfO4cd6mM= +github.com/golangci/go-tools v0.0.0-20190318060251-af6baa5dc196/go.mod h1:unzUULGw35sjyOYjUt0jMTXqHlZPpPc6e+xfO4cd6mM= github.com/golangci/goconst v0.0.0-20180610141641-041c5f2b40f3/go.mod h1:JXrF4TWy4tXYn62/9x8Wm/K/dm06p8tCKwFRDPZG/1o= github.com/golangci/gocyclo v0.0.0-20180528134321-2becd97e67ee/go.mod h1:ozx7R9SIwqmqf5pRP90DhR2Oay2UIjGuKheCBCNwAYU= github.com/golangci/gofmt v0.0.0-20181105071733-0b8337e80d98/go.mod h1:9qCChq59u/eW8im404Q2WWTrnBUQKjpNYKMbU4M7EFU= +github.com/golangci/gofmt v0.0.0-20181222123516-0b8337e80d98/go.mod h1:9qCChq59u/eW8im404Q2WWTrnBUQKjpNYKMbU4M7EFU= github.com/golangci/golangci-lint v1.17.1/go.mod h1:+5sJSl2h3aly+fpmL2meSP8CaSKua2E4Twi9LPy7b1g= github.com/golangci/gosec v0.0.0-20180901114220-66fb7fc33547/go.mod h1:0qUabqiIQgfmlAmulqxyiGkkyF6/tOGSnY2cnPVwrzU= +github.com/golangci/gosec v0.0.0-20190211064107-66fb7fc33547/go.mod h1:0qUabqiIQgfmlAmulqxyiGkkyF6/tOGSnY2cnPVwrzU= github.com/golangci/ineffassign v0.0.0-20180808204949-42439a7714cc/go.mod h1:e5tpTHCfVze+7EpLEozzMB3eafxo2KT5veNg1k6byQU= +github.com/golangci/ineffassign v0.0.0-20190609212857-42439a7714cc/go.mod h1:e5tpTHCfVze+7EpLEozzMB3eafxo2KT5veNg1k6byQU= github.com/golangci/lint-1 v0.0.0-20180610141402-ee948d087217/go.mod h1:66R6K6P6VWk9I95jvqGxkqJxVWGFy9XlDwLwVz1RCFg= +github.com/golangci/lint-1 v0.0.0-20190420132249-ee948d087217/go.mod h1:66R6K6P6VWk9I95jvqGxkqJxVWGFy9XlDwLwVz1RCFg= github.com/golangci/maligned v0.0.0-20180506175553-b1d89398deca/go.mod h1:tvlJhZqDe4LMs4ZHD0oMUlt9G2LWuDGoisJTBzLMV9o= github.com/golangci/misspell v0.0.0-20180809174111-950f5d19e770/go.mod h1:dEbvlSfYbMQDtrpRMQU675gSDLDNa8sCPPChZ7PhiVA= github.com/golangci/prealloc v0.0.0-20180630174525-215b22d4de21/go.mod h1:tf5+bzsHdTM0bsB7+8mt0GUMvjCgwLpTapNZHU8AajI= @@ -918,6 +925,7 @@ modernc.org/xc v1.0.0/go.mod h1:mRNCo0bvLjGhHO9WsyuKVU4q0ceiDDDoEeWDJHrNx8I= mvdan.cc/interfacer v0.0.0-20180901003855-c20040233aed/go.mod h1:Xkxe497xwlCKkIaQYRfC7CSLworTXY9RMqwhhCm+8Nc= mvdan.cc/lint v0.0.0-20170908181259-adc824a0674b/go.mod h1:2odslEg/xrtNQqCYg2/jCoyKnw3vv5biOc3JnIcYfL4= mvdan.cc/unparam v0.0.0-20190124213536-fbb59629db34/go.mod h1:H6SUd1XjIs+qQCyskXg5OFSrilMRUkD8ePJpHKDPaeY= +mvdan.cc/unparam v0.0.0-20190209190245-fbb59629db34/go.mod h1:H6SUd1XjIs+qQCyskXg5OFSrilMRUkD8ePJpHKDPaeY= sigs.k8s.io/kustomize v2.0.3+incompatible h1:JUufWFNlI44MdtnjUqVnvh29rR37PQFzPbLXqhyOyX0= sigs.k8s.io/kustomize v2.0.3+incompatible/go.mod h1:MkjgH3RdOWrievjo6c9T245dYlB5QeXV4WCbnt/PEpU= sigs.k8s.io/structured-merge-diff v0.0.0-20190426204423-ea680f03cc65/go.mod h1:wWxsB5ozmmv/SG7nM11ayaAW51xMvak/t1r0CSlcokI= From fb7c8fe069ff30b31efb6f8d524fc2b572d573fe Mon Sep 17 00:00:00 2001 From: Erik Wilson Date: Mon, 30 Sep 2019 16:24:35 -0700 Subject: [PATCH 3/4] Add github.com/Microsoft/hcsshim to go.mod --- go.mod | 8 +++----- go.sum | 39 +++++++++++++++++++++++++-------------- 2 files changed, 28 insertions(+), 19 deletions(-) diff --git a/go.mod b/go.mod index 505c302dc0..4735f713b7 100644 --- a/go.mod +++ b/go.mod @@ -3,6 +3,7 @@ module github.com/rancher/k3s go 1.13 replace ( + github.com/Microsoft/hcsshim => github.com/Microsoft/hcsshim v0.8.7-0.20190926181021-82c7525d98c8 github.com/containerd/btrfs => github.com/containerd/btrfs v0.0.0-20181101203652-af5082808c83 github.com/containerd/cgroups => github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601 github.com/containerd/console => github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50 @@ -58,17 +59,15 @@ replace ( k8s.io/sample-cli-plugin => github.com/rancher/kubernetes/staging/src/k8s.io/sample-cli-plugin v1.16.0-k3s.1 k8s.io/sample-controller => github.com/rancher/kubernetes/staging/src/k8s.io/sample-controller v1.16.0-k3s.1 mvdan.cc/unparam => mvdan.cc/unparam v0.0.0-20190209190245-fbb59629db34 -// github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options => github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options 82c7525d98c8 ) require ( - github.com/Microsoft/go-winio v0.4.14 // indirect github.com/NYTimes/gziphandler v1.1.1 // indirect github.com/bhendo/go-powershell v0.0.0-20190719160123-219e7fb4e41e // indirect github.com/bronze1man/goStrongswanVici v0.0.0-20190828090544-27d02f80ba40 // indirect github.com/buger/jsonparser v0.0.0-20181115193947-bf1c66bbce23 // indirect github.com/containerd/cgroups v0.0.0-20190923161937-abd0b19954a6 // indirect - github.com/containerd/containerd v1.2.8 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 github.com/containerd/continuity v0.0.0-20190827140505-75bee3e2ccb6 // indirect github.com/containerd/cri v1.11.1-0.20190909171321-f4d75d321c89 github.com/containerd/fifo v0.0.0-20190816180239-bda0ff6ed73c // indirect @@ -79,7 +78,6 @@ require ( github.com/coreos/flannel v0.11.0 github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e github.com/docker/docker v0.7.3-0.20190731001754-589f1dad8dad - github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c // indirect github.com/docker/go-metrics v0.0.1 // indirect github.com/docker/libnetwork v0.8.0-dev.2.0.20190624125649-f0e46a78ea34 // indirect github.com/go-bindata/go-bindata v3.1.2+incompatible @@ -114,7 +112,7 @@ require ( github.com/urfave/cli v1.21.0 go.etcd.io/bbolt v1.3.3 // indirect golang.org/x/net v0.0.0-20190812203447-cdfb69ac37fc - golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 google.golang.org/grpc v1.23.0 gopkg.in/mgo.v2 v2.0.0-20190816093944-a6b53ec6cb22 // indirect k8s.io/api v0.0.0 diff --git a/go.sum b/go.sum index c9e1598012..d52bf438e3 100644 --- a/go.sum +++ b/go.sum @@ -35,10 +35,10 @@ github.com/JeffAshton/win_pdh v0.0.0-20161109143554-76bb4ee9f0ab/go.mod h1:3VYc5 github.com/MakeNowJust/heredoc v0.0.0-20170808103936-bb23615498cd h1:sjQovDkwrZp8u+gxLtPgKGjk5hCxuy2hrRejBTA9xFU= github.com/MakeNowJust/heredoc v0.0.0-20170808103936-bb23615498cd/go.mod h1:64YHyfSL2R96J44Nlwm39UHepQbyR5q10x7iYa1ks2E= github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= -github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= -github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= -github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= -github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/hcsshim v0.8.7-0.20190926181021-82c7525d98c8 h1:gtZtklqA6kJUJ7l3aMd/qxT9PblTr808fEYnD6n25rA= +github.com/Microsoft/hcsshim v0.8.7-0.20190926181021-82c7525d98c8/go.mod h1:1+AuASoTkbeMyoDy6WXp10FyWKaYrUallNFrzRdUYBY= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= github.com/NYTimes/gziphandler v1.1.1 h1:ZUDjpQae29j0ryrS0u/B8HZfJBtBQHjqw2rQ2cqUQ3I= github.com/NYTimes/gziphandler v1.1.1/go.mod h1:n/CVRwUEOgIxrgPvAQhUUr9oeUtvrhMomdKFjzJNB0c= @@ -71,6 +71,7 @@ github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24 github.com/bhendo/go-powershell v0.0.0-20190719160123-219e7fb4e41e h1:KCjb01YiNoRaJ5c+SbnPLWjVzU9vqRYHg3e5JcN50nM= github.com/bhendo/go-powershell v0.0.0-20190719160123-219e7fb4e41e/go.mod h1:f7vw6ObmmNcyFQLhZX9eUGBJGpnwTJFDvVjqZxIxHWY= github.com/bifurcation/mint v0.0.0-20180715133206-93c51c6ce115/go.mod h1:zVt7zX3K/aDCk9Tj+VM7YymsX66ERvzCJzw8rFCX2JU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/blang/semver v3.5.0+incompatible h1:CGxCgetQ64DKk7rdZ++Vfnb1+ogGNnB17OJKJXD2Cfs= github.com/blang/semver v3.5.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/boltdb/bolt v1.3.1/go.mod h1:clJnj/oiGkjum5o1McbSZDSLxVThjynRyGBgiAx27Ps= @@ -108,6 +109,7 @@ github.com/containerd/go-cni v0.0.0-20190904155053-d20b7eebc7ee h1:fV37ZKnYs79fS github.com/containerd/go-cni v0.0.0-20190904155053-d20b7eebc7ee/go.mod h1:2wlRxCQdiBY+OcjNg5x8kI+5mEL1fGt25L4IzQHYJsM= github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda h1:3LYDkJtHAZGbWD75PoTBJuxldc+njsz9uSfjwIoOR6c= github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8 h1:jYCTS/16RWXXtVHNHo1KWNegd1kKQ7lHd7BStj/0hKw= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= @@ -202,7 +204,6 @@ github.com/go-acme/lego v2.5.0+incompatible/go.mod h1:yzMNe9CasVUhkquNvti5nAtPmG github.com/go-bindata/go-bindata v3.1.1+incompatible/go.mod h1:xK8Dsgwmeed+BBsSy2XTopBn/8uK2HWuGSnA11C3Joo= github.com/go-bindata/go-bindata v3.1.2+incompatible h1:5vjJMVhowQdPzjE1LdxyFF7YFTXg5IgGVW4gBr5IbvE= github.com/go-bindata/go-bindata v3.1.2+incompatible/go.mod h1:xK8Dsgwmeed+BBsSy2XTopBn/8uK2HWuGSnA11C3Joo= -github.com/go-critic/go-critic v0.0.0-20181204210945-1df300866540/go.mod h1:+sE8vrLDS2M0pZkBk0wy6+nLdKexVDrl/jBqQOTDThA= github.com/go-critic/go-critic v0.3.5-0.20190526074819-1df300866540/go.mod h1:+sE8vrLDS2M0pZkBk0wy6+nLdKexVDrl/jBqQOTDThA= github.com/go-lintpack/lintpack v0.5.2/go.mod h1:NwZuYi2nUHho8XEIZ6SIxihrnPoqBTDqfpXvXAN0sXM= github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= @@ -273,6 +274,7 @@ github.com/godbus/dbus v4.1.0+incompatible h1:WqqLRTsQic3apZUK9qC5sGNfXthmPXzUZ7 github.com/godbus/dbus v4.1.0+incompatible/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= github.com/gofrs/flock v0.7.1 h1:DP+LD/t0njgoPBvT5MJLeliUIVQR03hiKR6vezdwHlc= github.com/gofrs/flock v0.7.1/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= +github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= github.com/gogo/googleapis v1.3.0 h1:M695OaDJ5ipWvDPcoAg/YL9c3uORAegkEfBqTQF/fTQ= github.com/gogo/googleapis v1.3.0/go.mod h1:d+q1s/xVJxZGKWwC/6UfPIF33J+G1Tq4GYv9Y+Tg/EU= github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= @@ -296,21 +298,15 @@ github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/golangci/check v0.0.0-20180506172741-cfe4005ccda2/go.mod h1:k9Qvh+8juN+UKMCS/3jFtGICgW8O96FVaZsaxdzDkR4= github.com/golangci/dupl v0.0.0-20180902072040-3e9179ac440a/go.mod h1:ryS0uhF+x9jgbj/N71xsEqODy9BN81/GonCZiOzirOk= -github.com/golangci/errcheck v0.0.0-20181003203344-ef45e06d44b6/go.mod h1:DbHgvLiFKX1Sh2T1w8Q/h4NAI8MHIpzCdnBUDTXU3I0= github.com/golangci/errcheck v0.0.0-20181223084120-ef45e06d44b6/go.mod h1:DbHgvLiFKX1Sh2T1w8Q/h4NAI8MHIpzCdnBUDTXU3I0= github.com/golangci/go-misc v0.0.0-20180628070357-927a3d87b613/go.mod h1:SyvUF2NxV+sN8upjjeVYr5W7tyxaT1JVtvhKhOn2ii8= -github.com/golangci/go-tools v0.0.0-20180109140146-af6baa5dc196/go.mod h1:unzUULGw35sjyOYjUt0jMTXqHlZPpPc6e+xfO4cd6mM= github.com/golangci/go-tools v0.0.0-20190318060251-af6baa5dc196/go.mod h1:unzUULGw35sjyOYjUt0jMTXqHlZPpPc6e+xfO4cd6mM= github.com/golangci/goconst v0.0.0-20180610141641-041c5f2b40f3/go.mod h1:JXrF4TWy4tXYn62/9x8Wm/K/dm06p8tCKwFRDPZG/1o= github.com/golangci/gocyclo v0.0.0-20180528134321-2becd97e67ee/go.mod h1:ozx7R9SIwqmqf5pRP90DhR2Oay2UIjGuKheCBCNwAYU= -github.com/golangci/gofmt v0.0.0-20181105071733-0b8337e80d98/go.mod h1:9qCChq59u/eW8im404Q2WWTrnBUQKjpNYKMbU4M7EFU= github.com/golangci/gofmt v0.0.0-20181222123516-0b8337e80d98/go.mod h1:9qCChq59u/eW8im404Q2WWTrnBUQKjpNYKMbU4M7EFU= github.com/golangci/golangci-lint v1.17.1/go.mod h1:+5sJSl2h3aly+fpmL2meSP8CaSKua2E4Twi9LPy7b1g= -github.com/golangci/gosec v0.0.0-20180901114220-66fb7fc33547/go.mod h1:0qUabqiIQgfmlAmulqxyiGkkyF6/tOGSnY2cnPVwrzU= github.com/golangci/gosec v0.0.0-20190211064107-66fb7fc33547/go.mod h1:0qUabqiIQgfmlAmulqxyiGkkyF6/tOGSnY2cnPVwrzU= -github.com/golangci/ineffassign v0.0.0-20180808204949-42439a7714cc/go.mod h1:e5tpTHCfVze+7EpLEozzMB3eafxo2KT5veNg1k6byQU= github.com/golangci/ineffassign v0.0.0-20190609212857-42439a7714cc/go.mod h1:e5tpTHCfVze+7EpLEozzMB3eafxo2KT5veNg1k6byQU= -github.com/golangci/lint-1 v0.0.0-20180610141402-ee948d087217/go.mod h1:66R6K6P6VWk9I95jvqGxkqJxVWGFy9XlDwLwVz1RCFg= github.com/golangci/lint-1 v0.0.0-20190420132249-ee948d087217/go.mod h1:66R6K6P6VWk9I95jvqGxkqJxVWGFy9XlDwLwVz1RCFg= github.com/golangci/maligned v0.0.0-20180506175553-b1d89398deca/go.mod h1:tvlJhZqDe4LMs4ZHD0oMUlt9G2LWuDGoisJTBzLMV9o= github.com/golangci/misspell v0.0.0-20180809174111-950f5d19e770/go.mod h1:dEbvlSfYbMQDtrpRMQU675gSDLDNa8sCPPChZ7PhiVA= @@ -367,6 +363,8 @@ github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0 h1:Ovs26xHkKqVztRpIrF/92Bcuy github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk= github.com/grpc-ecosystem/grpc-gateway v1.3.0 h1:HJtP6RRwj2EpPCD/mhAWzSvLL/dFTdPm1UrWwanoFos= github.com/grpc-ecosystem/grpc-gateway v1.3.0/go.mod h1:RSKVYQBd5MCa4OVpNdGskqpgL2+G+NZTnrVHpWWfpdw= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-syslog v1.0.0/go.mod h1:qPfqrKkXGihmCqbJM2mZgkZGvKG1dFdvsLplgctolz4= github.com/hashicorp/golang-lru v0.0.0-20180201235237-0fb14efe8c47/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= @@ -522,14 +520,17 @@ github.com/onsi/gomega v1.4.3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1Cpa github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.0 h1:XPnZz8VVBHjVsy1vzJmRwIcSwiUO+JFfrv/xGiigmME= github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc2.0.20190611121236-6cc515888830 h1:yvQ/2Pupw60ON8TYEIGGTAI77yZsWYkiOeHFZWkwlCk= github.com/opencontainers/runc v1.0.0-rc2.0.20190611121236-6cc515888830/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runtime-spec v0.0.0-20180911193056-5684b8af48c1 h1:AcjCvgprf9I23wEYTHuyuHcuuQAp4hK5l+u1FUXgVaM= github.com/opencontainers/runtime-spec v0.0.0-20180911193056-5684b8af48c1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg= github.com/opencontainers/selinux v1.2.2/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs= github.com/pborman/uuid v1.2.0 h1:J7Q5mO4ysT1dv8hyrUGHb9+ooztCXu1D8MY8DZYsu3g= @@ -687,6 +688,8 @@ github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/syndtr/gocapability v0.0.0-20160928074757-e7cb7fa329f4 h1:w58e6FAOMd+rUgOfhaBb+ZVOQIOfUkpv5AAQVmf6hsI= github.com/syndtr/gocapability v0.0.0-20160928074757-e7cb7fa329f4/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs= github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I= github.com/tektoncd/pipeline v0.4.0/go.mod h1:IZzJdiX9EqEMuUcgdnElozdYYRh0/ZRC+NKMLj1K3Yw= @@ -697,6 +700,7 @@ github.com/timakin/bodyclose v0.0.0-20190407043127-4a873e97b2bb/go.mod h1:Qimiff github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8 h1:ndzgwNDnKIqyCvHTXaCqh9KlOWKvBry6nuXMJmonVsE= github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/urfave/cli v1.21.0 h1:wYSSj06510qPIzGSua9ZqsncMmWE3Zr55KBERygyrxE= github.com/urfave/cli v1.21.0/go.mod h1:lxDj6qX9Q6lWQxIrbrT0nwecwUtRnhVZAJjJZrVUZZQ= @@ -713,6 +717,9 @@ github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc h1:R83G5ikgLMxrB github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= github.com/vmware/govmomi v0.20.1 h1:7b/SeTUB3tER8ZLGLLLH3xcnB2xeuLULXmfPFqPSRZA= github.com/vmware/govmomi v0.20.1/go.mod h1:URlwyTFZX72RmxtxuaFL2Uj3fD1JTvZdx59bHWk6aFU= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xiang90/probing v0.0.0-20160813154853-07dd2e8dfe18 h1:MPPkRncZLN9Kh4MEFmbnK4h3BD7AUmskWv2+EeZJCCs= github.com/xiang90/probing v0.0.0-20160813154853-07dd2e8dfe18/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1 h1:j2hhcujLRHAg872RWAV5yaUrEjHEObwDv3aImCaNLek= @@ -722,6 +729,8 @@ go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= go.opencensus.io v0.21.0 h1:mU6zScU4U1YAFPHEHYk+3JC4SY7JxgkqS10ZOSyksNg= go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= go.uber.org/atomic v0.0.0-20181018215023-8dc6146f7569 h1:nSQar3Y0E3VQF/VdZ8PTAilaXpER+d7ypdABCrpwMdg= go.uber.org/atomic v0.0.0-20181018215023-8dc6146f7569/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= go.uber.org/multierr v0.0.0-20180122172545-ddea229ff1df h1:shvkWr0NAZkg4nPuE3XrKP0VuBPijjk3TfX6Y6acFNg= @@ -771,6 +780,7 @@ golang.org/x/net v0.0.0-20190313220215-9f648a60d977/go.mod h1:t9HGtf8HONx5eT2rtn golang.org/x/net v0.0.0-20190320064053-1272bf9dcd53/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190328230028-74de082e2cca/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190812203447-cdfb69ac37fc h1:gkKoSkUmnU6bpS/VhkuO27bzQeSA51uaEfbOW5dNb68= @@ -801,12 +811,13 @@ golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190321052220-f7bb7a8bee54/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190509141414-a5b02f93d862/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190730183949-1393eb018365/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e h1:TsjK5I7fXk8f2FQrgu6NS7i5Qih3knl2FL1htyguLRE= -golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.0.0-20170915090833-1cbadb444a80/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -855,6 +866,7 @@ google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg= google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= @@ -924,7 +936,6 @@ modernc.org/strutil v1.0.0/go.mod h1:lstksw84oURvj9y3tn8lGvRxyRC1S2+g5uuIzNfIOBs modernc.org/xc v1.0.0/go.mod h1:mRNCo0bvLjGhHO9WsyuKVU4q0ceiDDDoEeWDJHrNx8I= mvdan.cc/interfacer v0.0.0-20180901003855-c20040233aed/go.mod h1:Xkxe497xwlCKkIaQYRfC7CSLworTXY9RMqwhhCm+8Nc= mvdan.cc/lint v0.0.0-20170908181259-adc824a0674b/go.mod h1:2odslEg/xrtNQqCYg2/jCoyKnw3vv5biOc3JnIcYfL4= -mvdan.cc/unparam v0.0.0-20190124213536-fbb59629db34/go.mod h1:H6SUd1XjIs+qQCyskXg5OFSrilMRUkD8ePJpHKDPaeY= mvdan.cc/unparam v0.0.0-20190209190245-fbb59629db34/go.mod h1:H6SUd1XjIs+qQCyskXg5OFSrilMRUkD8ePJpHKDPaeY= sigs.k8s.io/kustomize v2.0.3+incompatible h1:JUufWFNlI44MdtnjUqVnvh29rR37PQFzPbLXqhyOyX0= sigs.k8s.io/kustomize v2.0.3+incompatible/go.mod h1:MkjgH3RdOWrievjo6c9T245dYlB5QeXV4WCbnt/PEpU= From ca70e11d54ef6c7eca642150f99e1edcf78b7f59 Mon Sep 17 00:00:00 2001 From: Erik Wilson Date: Mon, 30 Sep 2019 16:25:17 -0700 Subject: [PATCH 4/4] Update vendor --- vendor/github.com/Microsoft/go-winio/go.mod | 2 +- vendor/github.com/Microsoft/go-winio/go.sum | 2 + .../Microsoft/hcsshim/Protobuild.toml | 53 + .../github.com/Microsoft/hcsshim/appveyor.yml | 20 +- .../containerd-shim-runhcs-v1/options/doc.go | 1 + .../options/next.pb.txt | 0 .../options/runhcs.pb.go | 1143 +++++++++++++++++ .../options/runhcs.proto | 63 + .../github.com/Microsoft/hcsshim/container.go | 75 +- vendor/github.com/Microsoft/hcsshim/go.mod | 39 + vendor/github.com/Microsoft/hcsshim/go.sum | 142 ++ .../github.com/Microsoft/hcsshim/hcn/hcn.go | 2 +- .../Microsoft/hcsshim/hcn/hcnendpoint.go | 26 +- .../Microsoft/hcsshim/hcn/hcnerrors.go | 13 +- .../Microsoft/hcsshim/hcn/hcnglobals.go | 2 +- .../Microsoft/hcsshim/hcn/hcnloadbalancer.go | 12 +- .../Microsoft/hcsshim/hcn/hcnnamespace.go | 18 +- .../Microsoft/hcsshim/hcn/hcnnetwork.go | 49 +- .../Microsoft/hcsshim/hcn/hcnpolicy.go | 42 +- .../Microsoft/hcsshim/hnsendpoint.go | 10 + .../hcsshim/internal/cni/registry.go | 2 +- .../Microsoft/hcsshim/internal/cow/cow.go | 80 ++ .../hcsshim/internal/guestrequest/types.go | 100 -- .../Microsoft/hcsshim/internal/guid/guid.go | 69 - .../hcsshim/internal/hcs/callback.go | 102 +- .../Microsoft/hcsshim/internal/hcs/errors.go | 75 +- .../Microsoft/hcsshim/internal/hcs/hcs.go | 48 - .../Microsoft/hcsshim/internal/hcs/log.go | 20 - .../Microsoft/hcsshim/internal/hcs/process.go | 419 +++--- .../Microsoft/hcsshim/internal/hcs/system.go | 649 +++++----- .../hcsshim/internal/hcs/waithelper.go | 18 +- .../Microsoft/hcsshim/internal/hcs/watcher.go | 41 - .../hcsshim/internal/hns/hnsendpoint.go | 22 + .../hcsshim/internal/hns/hnsfuncs.go | 15 +- .../hcsshim/internal/hns/hnsnetwork.go | 10 +- .../hcsshim/internal/interop/interop.go | 4 - .../Microsoft/hcsshim/internal/log/g.go | 23 + .../Microsoft/hcsshim/internal/oc/exporter.go | 43 + .../Microsoft/hcsshim/internal/oc/span.go | 17 + .../hcsshim/internal/runhcs/container.go | 2 +- .../hcsshim/internal/schema1/schema1.go | 9 +- .../hcsshim/internal/schema2/attachment.go | 1 - .../schema2/cache_query_stats_response.go | 1 - .../hcsshim/internal/schema2/close_handle.go | 1 - .../hcsshim/internal/schema2/com_port.go | 1 - .../internal/schema2/compute_system.go | 3 +- .../hcsshim/internal/schema2/configuration.go | 32 +- .../hcsshim/internal/schema2/console_size.go | 1 - .../hcsshim/internal/schema2/container.go | 1 - .../schema2/container_memory_information.go | 1 - .../hcsshim/internal/schema2/devices.go | 1 - .../internal/schema2/enhanced_mode_video.go | 1 - .../internal/schema2/flexible_io_device.go | 1 - .../internal/schema2/guest_crash_reporting.go | 1 - .../hcsshim/internal/schema2/guest_os.go | 1 - .../hcsshim/internal/schema2/hosted_system.go | 1 - .../hcsshim/internal/schema2/hv_socket.go | 1 - .../hcsshim/internal/schema2/hv_socket_2.go | 1 - .../hcsshim/internal/schema2/layer.go | 1 - .../internal/schema2/mapped_directory.go | 1 - .../hcsshim/internal/schema2/mapped_pipe.go | 1 - .../hcsshim/internal/schema2/memory.go | 1 - .../schema2/memory_information_for_vm.go | 1 - .../hcsshim/internal/schema2/memory_stats.go | 1 - .../internal/schema2/network_adapter.go | 1 - .../hcsshim/internal/schema2/networking.go | 1 - .../internal/schema2/pause_notification.go | 1 - .../hcsshim/internal/schema2/pause_options.go | 1 - .../hcsshim/internal/schema2/plan9.go | 1 - .../hcsshim/internal/schema2/plan9_share.go | 3 +- .../internal/schema2/process_details.go | 1 - .../schema2/process_modify_request.go | 1 - .../internal/schema2/process_parameters.go | 1 - .../internal/schema2/process_status.go | 1 - .../hcsshim/internal/schema2/processor.go | 1 - .../hcsshim/internal/schema2/processor_2.go | 1 - .../internal/schema2/processor_stats.go | 1 - .../hcsshim/internal/schema2/properties.go | 1 - .../internal/schema2/property_query.go | 3 +- .../schema2/rdp_connection_options.go | 1 - .../internal/schema2/registry_changes.go | 1 - .../hcsshim/internal/schema2/registry_key.go | 1 - .../internal/schema2/registry_value.go | 1 - .../schema2/shared_memory_configuration.go | 1 - .../internal/schema2/shared_memory_region.go | 1 - .../schema2/shared_memory_region_info.go | 1 - .../internal/schema2/silo_properties.go | 1 - .../hcsshim/internal/schema2/statistics.go | 1 - .../hcsshim/internal/schema2/storage_qo_s.go | 1 - .../hcsshim/internal/schema2/storage_stats.go | 1 - .../hcsshim/internal/schema2/topology.go | 1 - .../hcsshim/internal/schema2/uefi.go | 1 - .../internal/schema2/uefi_boot_entry.go | 1 - .../hcsshim/internal/schema2/version.go | 1 - .../hcsshim/internal/schema2/video_monitor.go | 1 - .../internal/schema2/virtual_node_info.go | 1 - .../internal/schema2/virtual_p_mem_device.go | 1 - .../hcsshim/internal/schema2/virtual_smb.go | 1 - .../internal/schema2/virtual_smb_share.go | 1 - .../schema2/virtual_smb_share_options.go | 1 - .../hcsshim/internal/schema2/vm_memory.go | 1 - .../schema2/windows_crash_reporting.go | 1 - .../hcsshim/internal/vmcompute/vmcompute.go | 563 ++++++++ .../{hcs => vmcompute}/zsyscall_windows.go | 88 +- .../hcsshim/internal/wclayer/layerid.go | 2 +- .../hcsshim/internal/wclayer/layerutils.go | 2 +- .../hcsshim/internal/wclayer/nametoguid.go | 2 +- .../hcsshim/internal/wclayer/wclayer.go | 2 +- vendor/github.com/Microsoft/hcsshim/layer.go | 6 +- .../{osversion.go => osversion_windows.go} | 6 + .../hcsshim/osversion/windowsbuilds.go | 21 +- .../github.com/Microsoft/hcsshim/process.go | 38 +- .../github.com/Microsoft/hcsshim/vendor.conf | 21 - .../capability/capability_linux.go | 4 +- vendor/go.opencensus.io/README.md | 6 +- vendor/go.opencensus.io/go.mod | 14 +- vendor/go.opencensus.io/go.sum | 27 +- vendor/go.opencensus.io/opencensus.go | 2 +- .../stats/view/view_to_metric.go | 4 +- vendor/go.opencensus.io/tag/key.go | 10 + vendor/golang.org/x/sys/cpu/byteorder.go | 38 +- vendor/golang.org/x/sys/cpu/cpu_linux.go | 2 +- .../golang.org/x/sys/unix/affinity_linux.go | 46 +- vendor/golang.org/x/sys/unix/ioctl.go | 41 +- vendor/golang.org/x/sys/unix/mkerrors.sh | 42 +- vendor/golang.org/x/sys/unix/syscall_aix.go | 39 +- .../golang.org/x/sys/unix/syscall_aix_ppc.go | 4 + .../x/sys/unix/syscall_aix_ppc64.go | 4 + vendor/golang.org/x/sys/unix/syscall_bsd.go | 2 - .../golang.org/x/sys/unix/syscall_darwin.go | 38 - .../x/sys/unix/syscall_darwin_386.go | 7 + .../x/sys/unix/syscall_darwin_amd64.go | 7 + .../x/sys/unix/syscall_darwin_arm.go | 12 + .../x/sys/unix/syscall_darwin_arm64.go | 12 + .../x/sys/unix/syscall_dragonfly.go | 39 +- .../x/sys/unix/syscall_dragonfly_amd64.go | 4 + .../golang.org/x/sys/unix/syscall_freebsd.go | 39 +- .../x/sys/unix/syscall_freebsd_386.go | 4 + .../x/sys/unix/syscall_freebsd_amd64.go | 4 + .../x/sys/unix/syscall_freebsd_arm.go | 4 + .../x/sys/unix/syscall_freebsd_arm64.go | 4 + vendor/golang.org/x/sys/unix/syscall_linux.go | 130 +- .../x/sys/unix/syscall_linux_386.go | 4 + .../x/sys/unix/syscall_linux_amd64.go | 4 + .../x/sys/unix/syscall_linux_arm.go | 4 + .../x/sys/unix/syscall_linux_arm64.go | 4 + .../x/sys/unix/syscall_linux_mips64x.go | 4 + .../x/sys/unix/syscall_linux_mipsx.go | 4 + .../x/sys/unix/syscall_linux_ppc64x.go | 4 + .../x/sys/unix/syscall_linux_riscv64.go | 4 + .../x/sys/unix/syscall_linux_s390x.go | 4 + .../x/sys/unix/syscall_linux_sparc64.go | 4 + .../golang.org/x/sys/unix/syscall_netbsd.go | 39 +- .../x/sys/unix/syscall_netbsd_386.go | 4 + .../x/sys/unix/syscall_netbsd_amd64.go | 4 + .../x/sys/unix/syscall_netbsd_arm.go | 4 + .../x/sys/unix/syscall_netbsd_arm64.go | 4 + .../golang.org/x/sys/unix/syscall_openbsd.go | 39 +- .../x/sys/unix/syscall_openbsd_386.go | 4 + .../x/sys/unix/syscall_openbsd_amd64.go | 4 + .../x/sys/unix/syscall_openbsd_arm.go | 4 + .../x/sys/unix/syscall_openbsd_arm64.go | 4 + .../golang.org/x/sys/unix/syscall_solaris.go | 30 - .../x/sys/unix/syscall_solaris_amd64.go | 4 + .../x/sys/unix/zerrors_linux_386.go | 116 +- .../x/sys/unix/zerrors_linux_amd64.go | 116 +- .../x/sys/unix/zerrors_linux_arm.go | 116 +- .../x/sys/unix/zerrors_linux_arm64.go | 118 +- .../x/sys/unix/zerrors_linux_mips.go | 116 +- .../x/sys/unix/zerrors_linux_mips64.go | 116 +- .../x/sys/unix/zerrors_linux_mips64le.go | 116 +- .../x/sys/unix/zerrors_linux_mipsle.go | 116 +- .../x/sys/unix/zerrors_linux_ppc64.go | 116 +- .../x/sys/unix/zerrors_linux_ppc64le.go | 116 +- .../x/sys/unix/zerrors_linux_riscv64.go | 116 +- .../x/sys/unix/zerrors_linux_s390x.go | 116 +- .../x/sys/unix/zerrors_linux_sparc64.go | 116 +- .../x/sys/unix/zsyscall_darwin_386.1_11.go | 20 +- .../x/sys/unix/zsyscall_darwin_386.go | 87 +- .../x/sys/unix/zsyscall_darwin_386.s | 10 +- .../x/sys/unix/zsyscall_darwin_amd64.1_11.go | 52 +- .../x/sys/unix/zsyscall_darwin_amd64.go | 72 +- .../x/sys/unix/zsyscall_darwin_amd64.s | 8 +- .../x/sys/unix/zsyscall_darwin_arm.1_11.go | 26 - .../x/sys/unix/zsyscall_darwin_arm.go | 51 +- .../x/sys/unix/zsyscall_darwin_arm.s | 2 - .../x/sys/unix/zsyscall_darwin_arm64.1_11.go | 26 - .../x/sys/unix/zsyscall_darwin_arm64.go | 51 +- .../x/sys/unix/zsyscall_darwin_arm64.s | 6 +- .../x/sys/unix/zsysnum_linux_386.go | 2 + .../x/sys/unix/zsysnum_linux_amd64.go | 2 + .../x/sys/unix/zsysnum_linux_arm.go | 2 + .../x/sys/unix/zsysnum_linux_arm64.go | 1 + .../x/sys/unix/zsysnum_linux_mips.go | 1 + .../x/sys/unix/zsysnum_linux_mips64.go | 1 + .../x/sys/unix/zsysnum_linux_mips64le.go | 1 + .../x/sys/unix/zsysnum_linux_mipsle.go | 1 + .../x/sys/unix/zsysnum_linux_ppc64.go | 2 + .../x/sys/unix/zsysnum_linux_ppc64le.go | 2 + .../x/sys/unix/zsysnum_linux_riscv64.go | 2 + .../x/sys/unix/zsysnum_linux_s390x.go | 2 + .../x/sys/unix/zsysnum_linux_sparc64.go | 1 + .../golang.org/x/sys/unix/ztypes_linux_386.go | 71 + .../x/sys/unix/ztypes_linux_amd64.go | 71 + .../golang.org/x/sys/unix/ztypes_linux_arm.go | 71 + .../x/sys/unix/ztypes_linux_arm64.go | 71 + .../x/sys/unix/ztypes_linux_mips.go | 71 + .../x/sys/unix/ztypes_linux_mips64.go | 71 + .../x/sys/unix/ztypes_linux_mips64le.go | 71 + .../x/sys/unix/ztypes_linux_mipsle.go | 71 + .../x/sys/unix/ztypes_linux_ppc64.go | 71 + .../x/sys/unix/ztypes_linux_ppc64le.go | 71 + .../x/sys/unix/ztypes_linux_riscv64.go | 71 + .../x/sys/unix/ztypes_linux_s390x.go | 71 + .../x/sys/unix/ztypes_linux_sparc64.go | 71 + .../x/sys/windows/security_windows.go | 44 +- .../x/sys/windows/syscall_windows.go | 22 +- .../golang.org/x/sys/windows/types_windows.go | 87 ++ .../x/sys/windows/zsyscall_windows.go | 184 +++ vendor/modules.txt | 31 +- 220 files changed, 6517 insertions(+), 1819 deletions(-) create mode 100644 vendor/github.com/Microsoft/hcsshim/Protobuild.toml create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/next.pb.txt create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto create mode 100644 vendor/github.com/Microsoft/hcsshim/go.mod create mode 100644 vendor/github.com/Microsoft/hcsshim/go.sum create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/log/g.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/span.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go rename vendor/github.com/Microsoft/hcsshim/internal/{hcs => vmcompute}/zsyscall_windows.go (81%) rename vendor/github.com/Microsoft/hcsshim/osversion/{osversion.go => osversion_windows.go} (88%) delete mode 100644 vendor/github.com/Microsoft/hcsshim/vendor.conf diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod index b3846826b4..50b9d6e2ec 100644 --- a/vendor/github.com/Microsoft/go-winio/go.mod +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -5,5 +5,5 @@ go 1.12 require ( github.com/pkg/errors v0.8.1 github.com/sirupsen/logrus v1.4.1 - golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 ) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum index babb4a70df..209aa8cf4d 100644 --- a/vendor/github.com/Microsoft/go-winio/go.sum +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 0000000000..e2dd2d3a7a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,53 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a5939..7f0f816329 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.12.9 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe' \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go new file mode 100644 index 0000000000..0684d05963 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go @@ -0,0 +1 @@ +package options diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/next.pb.txt b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/next.pb.txt new file mode 100644 index 0000000000..e69de29bb2 diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go new file mode 100644 index 0000000000..e805b3e5f6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go @@ -0,0 +1,1143 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto + +package options + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + _ "github.com/gogo/protobuf/types" + github_com_gogo_protobuf_types "github.com/gogo/protobuf/types" + io "io" + math "math" + reflect "reflect" + strings "strings" + time "time" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Options_DebugType int32 + +const ( + Options_NPIPE Options_DebugType = 0 + Options_FILE Options_DebugType = 1 + Options_ETW Options_DebugType = 2 +) + +var Options_DebugType_name = map[int32]string{ + 0: "NPIPE", + 1: "FILE", + 2: "ETW", +} + +var Options_DebugType_value = map[string]int32{ + "NPIPE": 0, + "FILE": 1, + "ETW": 2, +} + +func (x Options_DebugType) String() string { + return proto.EnumName(Options_DebugType_name, int32(x)) +} + +func (Options_DebugType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0, 0} +} + +type Options_SandboxIsolation int32 + +const ( + Options_PROCESS Options_SandboxIsolation = 0 + Options_HYPERVISOR Options_SandboxIsolation = 1 +) + +var Options_SandboxIsolation_name = map[int32]string{ + 0: "PROCESS", + 1: "HYPERVISOR", +} + +var Options_SandboxIsolation_value = map[string]int32{ + "PROCESS": 0, + "HYPERVISOR": 1, +} + +func (x Options_SandboxIsolation) String() string { + return proto.EnumName(Options_SandboxIsolation_name, int32(x)) +} + +func (Options_SandboxIsolation) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0, 1} +} + +// Options are the set of customizations that can be passed at Create time. +type Options struct { + // enable debug tracing + Debug bool `protobuf:"varint,1,opt,name=debug,proto3" json:"debug,omitempty"` + // debug tracing output type + DebugType Options_DebugType `protobuf:"varint,2,opt,name=debug_type,json=debugType,proto3,enum=containerd.runhcs.v1.Options_DebugType" json:"debug_type,omitempty"` + // registry key root for storage of the runhcs container state + RegistryRoot string `protobuf:"bytes,3,opt,name=registry_root,json=registryRoot,proto3" json:"registry_root,omitempty"` + // sandbox_image is the image to use for the sandbox that matches the + // sandbox_platform. + SandboxImage string `protobuf:"bytes,4,opt,name=sandbox_image,json=sandboxImage,proto3" json:"sandbox_image,omitempty"` + // sandbox_platform is a CRI setting that specifies the platform + // architecture for all sandbox's in this runtime. Values are + // 'windows/amd64' and 'linux/amd64'. + SandboxPlatform string `protobuf:"bytes,5,opt,name=sandbox_platform,json=sandboxPlatform,proto3" json:"sandbox_platform,omitempty"` + // sandbox_isolation is a CRI setting that specifies the isolation level of + // the sandbox. For Windows runtime PROCESS and HYPERVISOR are valid. For + // LCOW only HYPERVISOR is valid and default if omitted. + SandboxIsolation Options_SandboxIsolation `protobuf:"varint,6,opt,name=sandbox_isolation,json=sandboxIsolation,proto3,enum=containerd.runhcs.v1.Options_SandboxIsolation" json:"sandbox_isolation,omitempty"` + // boot_files_root_path is the path to the directory containing the LCOW + // kernel and root FS files. + BootFilesRootPath string `protobuf:"bytes,7,opt,name=boot_files_root_path,json=bootFilesRootPath,proto3" json:"boot_files_root_path,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Options) Reset() { *m = Options{} } +func (*Options) ProtoMessage() {} +func (*Options) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0} +} +func (m *Options) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Options) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Options.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Options) XXX_Merge(src proto.Message) { + xxx_messageInfo_Options.Merge(m, src) +} +func (m *Options) XXX_Size() int { + return m.Size() +} +func (m *Options) XXX_DiscardUnknown() { + xxx_messageInfo_Options.DiscardUnknown(m) +} + +var xxx_messageInfo_Options proto.InternalMessageInfo + +// ProcessDetails contains additional information about a process. This is the additional +// info returned in the Pids query. +type ProcessDetails struct { + ImageName string `protobuf:"bytes,1,opt,name=image_name,json=imageName,proto3" json:"image_name,omitempty"` + CreatedAt time.Time `protobuf:"bytes,2,opt,name=created_at,json=createdAt,proto3,stdtime" json:"created_at"` + KernelTime_100Ns uint64 `protobuf:"varint,3,opt,name=kernel_time_100_ns,json=kernelTime100Ns,proto3" json:"kernel_time_100_ns,omitempty"` + MemoryCommitBytes uint64 `protobuf:"varint,4,opt,name=memory_commit_bytes,json=memoryCommitBytes,proto3" json:"memory_commit_bytes,omitempty"` + MemoryWorkingSetPrivateBytes uint64 `protobuf:"varint,5,opt,name=memory_working_set_private_bytes,json=memoryWorkingSetPrivateBytes,proto3" json:"memory_working_set_private_bytes,omitempty"` + MemoryWorkingSetSharedBytes uint64 `protobuf:"varint,6,opt,name=memory_working_set_shared_bytes,json=memoryWorkingSetSharedBytes,proto3" json:"memory_working_set_shared_bytes,omitempty"` + ProcessID uint32 `protobuf:"varint,7,opt,name=process_id,json=processId,proto3" json:"process_id,omitempty"` + UserTime_100Ns uint64 `protobuf:"varint,8,opt,name=user_time_100_ns,json=userTime100Ns,proto3" json:"user_time_100_ns,omitempty"` + ExecID string `protobuf:"bytes,9,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ProcessDetails) Reset() { *m = ProcessDetails{} } +func (*ProcessDetails) ProtoMessage() {} +func (*ProcessDetails) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{1} +} +func (m *ProcessDetails) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *ProcessDetails) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_ProcessDetails.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *ProcessDetails) XXX_Merge(src proto.Message) { + xxx_messageInfo_ProcessDetails.Merge(m, src) +} +func (m *ProcessDetails) XXX_Size() int { + return m.Size() +} +func (m *ProcessDetails) XXX_DiscardUnknown() { + xxx_messageInfo_ProcessDetails.DiscardUnknown(m) +} + +var xxx_messageInfo_ProcessDetails proto.InternalMessageInfo + +func init() { + proto.RegisterEnum("containerd.runhcs.v1.Options_DebugType", Options_DebugType_name, Options_DebugType_value) + proto.RegisterEnum("containerd.runhcs.v1.Options_SandboxIsolation", Options_SandboxIsolation_name, Options_SandboxIsolation_value) + proto.RegisterType((*Options)(nil), "containerd.runhcs.v1.Options") + proto.RegisterType((*ProcessDetails)(nil), "containerd.runhcs.v1.ProcessDetails") +} + +func init() { + proto.RegisterFile("github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto", fileDescriptor_b643df6839c75082) +} + +var fileDescriptor_b643df6839c75082 = []byte{ + // 704 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x54, 0x4d, 0x6f, 0xda, 0x48, + 0x18, 0xc6, 0xe1, 0xd3, 0x6f, 0x96, 0xc4, 0x99, 0xe5, 0x80, 0xb2, 0xbb, 0x80, 0xc8, 0x21, 0x89, + 0x76, 0x63, 0x43, 0xf6, 0xd8, 0x53, 0x09, 0xa0, 0xba, 0x6a, 0x83, 0x65, 0xa2, 0xa6, 0x1f, 0x07, + 0xcb, 0xd8, 0x83, 0xb1, 0x82, 0x3d, 0xd6, 0xcc, 0x90, 0x86, 0x5b, 0x7f, 0x42, 0x7f, 0x55, 0x95, + 0x63, 0x8f, 0x95, 0x2a, 0xa5, 0x0d, 0xbf, 0xa4, 0x9a, 0xb1, 0x49, 0xd4, 0x28, 0xea, 0xa5, 0x27, + 0xc6, 0xcf, 0xf3, 0xbc, 0xcf, 0xfb, 0x29, 0x60, 0x14, 0x84, 0x7c, 0xb6, 0x98, 0xe8, 0x1e, 0x89, + 0x8c, 0x97, 0xa1, 0x47, 0x09, 0x23, 0x53, 0x6e, 0xcc, 0x3c, 0xc6, 0x66, 0x61, 0x64, 0x78, 0x91, + 0x6f, 0x78, 0x24, 0xe6, 0x6e, 0x18, 0x63, 0xea, 0x1f, 0x09, 0xec, 0x88, 0x2e, 0xe2, 0x99, 0xc7, + 0x8e, 0x2e, 0xbb, 0x06, 0x49, 0x78, 0x48, 0x62, 0x66, 0xa4, 0x88, 0x9e, 0x50, 0xc2, 0x09, 0xaa, + 0xdd, 0xeb, 0xf5, 0x8c, 0xb8, 0xec, 0xee, 0xd6, 0x02, 0x12, 0x10, 0x29, 0x30, 0xc4, 0x2b, 0xd5, + 0xee, 0x36, 0x03, 0x42, 0x82, 0x39, 0x36, 0xe4, 0xd7, 0x64, 0x31, 0x35, 0x78, 0x18, 0x61, 0xc6, + 0xdd, 0x28, 0x49, 0x05, 0xed, 0x4f, 0x79, 0x28, 0x8f, 0xd2, 0x2c, 0xa8, 0x06, 0x45, 0x1f, 0x4f, + 0x16, 0x41, 0x5d, 0x69, 0x29, 0x07, 0x15, 0x3b, 0xfd, 0x40, 0x43, 0x00, 0xf9, 0x70, 0xf8, 0x32, + 0xc1, 0xf5, 0x8d, 0x96, 0x72, 0xb0, 0x75, 0xbc, 0xaf, 0x3f, 0x56, 0x83, 0x9e, 0x19, 0xe9, 0x7d, + 0xa1, 0x3f, 0x5b, 0x26, 0xd8, 0x56, 0xfd, 0xf5, 0x13, 0xed, 0x41, 0x95, 0xe2, 0x20, 0x64, 0x9c, + 0x2e, 0x1d, 0x4a, 0x08, 0xaf, 0xe7, 0x5b, 0xca, 0x81, 0x6a, 0xff, 0xb1, 0x06, 0x6d, 0x42, 0xb8, + 0x10, 0x31, 0x37, 0xf6, 0x27, 0xe4, 0xca, 0x09, 0x23, 0x37, 0xc0, 0xf5, 0x42, 0x2a, 0xca, 0x40, + 0x53, 0x60, 0xe8, 0x10, 0xb4, 0xb5, 0x28, 0x99, 0xbb, 0x7c, 0x4a, 0x68, 0x54, 0x2f, 0x4a, 0xdd, + 0x76, 0x86, 0x5b, 0x19, 0x8c, 0xde, 0xc1, 0xce, 0x9d, 0x1f, 0x23, 0x73, 0x57, 0xd4, 0x57, 0x2f, + 0xc9, 0x1e, 0xf4, 0x5f, 0xf7, 0x30, 0xce, 0x32, 0xae, 0xa3, 0xec, 0x75, 0xce, 0x3b, 0x04, 0x19, + 0x50, 0x9b, 0x10, 0xc2, 0x9d, 0x69, 0x38, 0xc7, 0x4c, 0xf6, 0xe4, 0x24, 0x2e, 0x9f, 0xd5, 0xcb, + 0xb2, 0x96, 0x1d, 0xc1, 0x0d, 0x05, 0x25, 0x3a, 0xb3, 0x5c, 0x3e, 0x6b, 0x1f, 0x82, 0x7a, 0x37, + 0x1a, 0xa4, 0x42, 0xf1, 0xd4, 0x32, 0xad, 0x81, 0x96, 0x43, 0x15, 0x28, 0x0c, 0xcd, 0x17, 0x03, + 0x4d, 0x41, 0x65, 0xc8, 0x0f, 0xce, 0xce, 0xb5, 0x8d, 0xb6, 0x01, 0xda, 0xc3, 0x0a, 0xd0, 0x26, + 0x94, 0x2d, 0x7b, 0x74, 0x32, 0x18, 0x8f, 0xb5, 0x1c, 0xda, 0x02, 0x78, 0xf6, 0xc6, 0x1a, 0xd8, + 0xaf, 0xcc, 0xf1, 0xc8, 0xd6, 0x94, 0xf6, 0xd7, 0x3c, 0x6c, 0x59, 0x94, 0x78, 0x98, 0xb1, 0x3e, + 0xe6, 0x6e, 0x38, 0x67, 0xe8, 0x1f, 0x00, 0x39, 0x44, 0x27, 0x76, 0x23, 0x2c, 0x97, 0xaa, 0xda, + 0xaa, 0x44, 0x4e, 0xdd, 0x08, 0xa3, 0x13, 0x00, 0x8f, 0x62, 0x97, 0x63, 0xdf, 0x71, 0xb9, 0x5c, + 0xec, 0xe6, 0xf1, 0xae, 0x9e, 0x1e, 0x8c, 0xbe, 0x3e, 0x18, 0xfd, 0x6c, 0x7d, 0x30, 0xbd, 0xca, + 0xf5, 0x4d, 0x33, 0xf7, 0xf1, 0x5b, 0x53, 0xb1, 0xd5, 0x2c, 0xee, 0x29, 0x47, 0xff, 0x02, 0xba, + 0xc0, 0x34, 0xc6, 0x73, 0x47, 0x5c, 0x96, 0xd3, 0xed, 0x74, 0x9c, 0x98, 0xc9, 0xd5, 0x16, 0xec, + 0xed, 0x94, 0x11, 0x0e, 0xdd, 0x4e, 0xe7, 0x94, 0x21, 0x1d, 0xfe, 0x8c, 0x70, 0x44, 0xe8, 0xd2, + 0xf1, 0x48, 0x14, 0x85, 0xdc, 0x99, 0x2c, 0x39, 0x66, 0x72, 0xc7, 0x05, 0x7b, 0x27, 0xa5, 0x4e, + 0x24, 0xd3, 0x13, 0x04, 0x1a, 0x42, 0x2b, 0xd3, 0xbf, 0x27, 0xf4, 0x22, 0x8c, 0x03, 0x87, 0x61, + 0xee, 0x24, 0x34, 0xbc, 0x74, 0x39, 0xce, 0x82, 0x8b, 0x32, 0xf8, 0xef, 0x54, 0x77, 0x9e, 0xca, + 0xc6, 0x98, 0x5b, 0xa9, 0x28, 0xf5, 0xe9, 0x43, 0xf3, 0x11, 0x1f, 0x36, 0x73, 0x29, 0xf6, 0x33, + 0x9b, 0x92, 0xb4, 0xf9, 0xeb, 0xa1, 0xcd, 0x58, 0x6a, 0x52, 0x97, 0xff, 0x00, 0x92, 0x74, 0xc0, + 0x4e, 0xe8, 0xcb, 0x25, 0x57, 0x7b, 0xd5, 0xd5, 0x4d, 0x53, 0xcd, 0xc6, 0x6e, 0xf6, 0x6d, 0x35, + 0x13, 0x98, 0x3e, 0xda, 0x07, 0x6d, 0xc1, 0x30, 0xfd, 0x69, 0x2c, 0x15, 0x99, 0xa4, 0x2a, 0xf0, + 0xfb, 0xa1, 0xec, 0x41, 0x19, 0x5f, 0x61, 0x4f, 0x78, 0xaa, 0x62, 0x45, 0x3d, 0x58, 0xdd, 0x34, + 0x4b, 0x83, 0x2b, 0xec, 0x99, 0x7d, 0xbb, 0x24, 0x28, 0xd3, 0xef, 0xf9, 0xd7, 0xb7, 0x8d, 0xdc, + 0x97, 0xdb, 0x46, 0xee, 0xc3, 0xaa, 0xa1, 0x5c, 0xaf, 0x1a, 0xca, 0xe7, 0x55, 0x43, 0xf9, 0xbe, + 0x6a, 0x28, 0x6f, 0x9f, 0xff, 0xfe, 0xdf, 0xcb, 0x93, 0xec, 0xf7, 0x75, 0x6e, 0x52, 0x92, 0x7b, + 0xff, 0xff, 0x47, 0x00, 0x00, 0x00, 0xff, 0xff, 0xa3, 0x9a, 0x54, 0x17, 0xb5, 0x04, 0x00, 0x00, +} + +func (m *Options) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Options) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Debug { + dAtA[i] = 0x8 + i++ + if m.Debug { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if m.DebugType != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.DebugType)) + } + if len(m.RegistryRoot) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.RegistryRoot))) + i += copy(dAtA[i:], m.RegistryRoot) + } + if len(m.SandboxImage) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.SandboxImage))) + i += copy(dAtA[i:], m.SandboxImage) + } + if len(m.SandboxPlatform) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.SandboxPlatform))) + i += copy(dAtA[i:], m.SandboxPlatform) + } + if m.SandboxIsolation != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.SandboxIsolation)) + } + if len(m.BootFilesRootPath) > 0 { + dAtA[i] = 0x3a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.BootFilesRootPath))) + i += copy(dAtA[i:], m.BootFilesRootPath) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *ProcessDetails) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ProcessDetails) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ImageName) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.ImageName))) + i += copy(dAtA[i:], m.ImageName) + } + dAtA[i] = 0x12 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt))) + n1, err := github_com_gogo_protobuf_types.StdTimeMarshalTo(m.CreatedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + if m.KernelTime_100Ns != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.KernelTime_100Ns)) + } + if m.MemoryCommitBytes != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryCommitBytes)) + } + if m.MemoryWorkingSetPrivateBytes != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryWorkingSetPrivateBytes)) + } + if m.MemoryWorkingSetSharedBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryWorkingSetSharedBytes)) + } + if m.ProcessID != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.ProcessID)) + } + if m.UserTime_100Ns != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.UserTime_100Ns)) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x4a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintRunhcs(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Options) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Debug { + n += 2 + } + if m.DebugType != 0 { + n += 1 + sovRunhcs(uint64(m.DebugType)) + } + l = len(m.RegistryRoot) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = len(m.SandboxImage) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = len(m.SandboxPlatform) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.SandboxIsolation != 0 { + n += 1 + sovRunhcs(uint64(m.SandboxIsolation)) + } + l = len(m.BootFilesRootPath) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *ProcessDetails) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.ImageName) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt) + n += 1 + l + sovRunhcs(uint64(l)) + if m.KernelTime_100Ns != 0 { + n += 1 + sovRunhcs(uint64(m.KernelTime_100Ns)) + } + if m.MemoryCommitBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryCommitBytes)) + } + if m.MemoryWorkingSetPrivateBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryWorkingSetPrivateBytes)) + } + if m.MemoryWorkingSetSharedBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryWorkingSetSharedBytes)) + } + if m.ProcessID != 0 { + n += 1 + sovRunhcs(uint64(m.ProcessID)) + } + if m.UserTime_100Ns != 0 { + n += 1 + sovRunhcs(uint64(m.UserTime_100Ns)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovRunhcs(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozRunhcs(x uint64) (n int) { + return sovRunhcs(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Options) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Options{`, + `Debug:` + fmt.Sprintf("%v", this.Debug) + `,`, + `DebugType:` + fmt.Sprintf("%v", this.DebugType) + `,`, + `RegistryRoot:` + fmt.Sprintf("%v", this.RegistryRoot) + `,`, + `SandboxImage:` + fmt.Sprintf("%v", this.SandboxImage) + `,`, + `SandboxPlatform:` + fmt.Sprintf("%v", this.SandboxPlatform) + `,`, + `SandboxIsolation:` + fmt.Sprintf("%v", this.SandboxIsolation) + `,`, + `BootFilesRootPath:` + fmt.Sprintf("%v", this.BootFilesRootPath) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *ProcessDetails) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ProcessDetails{`, + `ImageName:` + fmt.Sprintf("%v", this.ImageName) + `,`, + `CreatedAt:` + strings.Replace(strings.Replace(this.CreatedAt.String(), "Timestamp", "types.Timestamp", 1), `&`, ``, 1) + `,`, + `KernelTime_100Ns:` + fmt.Sprintf("%v", this.KernelTime_100Ns) + `,`, + `MemoryCommitBytes:` + fmt.Sprintf("%v", this.MemoryCommitBytes) + `,`, + `MemoryWorkingSetPrivateBytes:` + fmt.Sprintf("%v", this.MemoryWorkingSetPrivateBytes) + `,`, + `MemoryWorkingSetSharedBytes:` + fmt.Sprintf("%v", this.MemoryWorkingSetSharedBytes) + `,`, + `ProcessID:` + fmt.Sprintf("%v", this.ProcessID) + `,`, + `UserTime_100Ns:` + fmt.Sprintf("%v", this.UserTime_100Ns) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringRunhcs(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Options) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Options: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Options: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Debug", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.Debug = bool(v != 0) + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field DebugType", wireType) + } + m.DebugType = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.DebugType |= Options_DebugType(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field RegistryRoot", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.RegistryRoot = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxImage", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SandboxImage = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxPlatform", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SandboxPlatform = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxIsolation", wireType) + } + m.SandboxIsolation = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.SandboxIsolation |= Options_SandboxIsolation(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field BootFilesRootPath", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.BootFilesRootPath = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipRunhcs(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ProcessDetails) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ProcessDetails: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ProcessDetails: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ImageName", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ImageName = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CreatedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := github_com_gogo_protobuf_types.StdTimeUnmarshal(&m.CreatedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTime_100Ns", wireType) + } + m.KernelTime_100Ns = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.KernelTime_100Ns |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryCommitBytes", wireType) + } + m.MemoryCommitBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryCommitBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryWorkingSetPrivateBytes", wireType) + } + m.MemoryWorkingSetPrivateBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryWorkingSetPrivateBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryWorkingSetSharedBytes", wireType) + } + m.MemoryWorkingSetSharedBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryWorkingSetSharedBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ProcessID", wireType) + } + m.ProcessID = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ProcessID |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field UserTime_100Ns", wireType) + } + m.UserTime_100Ns = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.UserTime_100Ns |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipRunhcs(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipRunhcs(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthRunhcs + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipRunhcs(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthRunhcs = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowRunhcs = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto new file mode 100644 index 0000000000..9d6852a0a0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto @@ -0,0 +1,63 @@ +syntax = "proto3"; + +package containerd.runhcs.v1; + +import weak "gogoproto/gogo.proto"; +import "google/protobuf/timestamp.proto"; + +option go_package = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options;options"; + +// Options are the set of customizations that can be passed at Create time. +message Options { + // enable debug tracing + bool debug = 1; + + enum DebugType { + NPIPE = 0; + FILE = 1; + ETW = 2; + } + + // debug tracing output type + DebugType debug_type = 2; + + // registry key root for storage of the runhcs container state + string registry_root = 3; + + // sandbox_image is the image to use for the sandbox that matches the + // sandbox_platform. + string sandbox_image = 4; + + // sandbox_platform is a CRI setting that specifies the platform + // architecture for all sandbox's in this runtime. Values are + // 'windows/amd64' and 'linux/amd64'. + string sandbox_platform = 5; + + enum SandboxIsolation { + PROCESS = 0; + HYPERVISOR = 1; + } + + // sandbox_isolation is a CRI setting that specifies the isolation level of + // the sandbox. For Windows runtime PROCESS and HYPERVISOR are valid. For + // LCOW only HYPERVISOR is valid and default if omitted. + SandboxIsolation sandbox_isolation = 6; + + // boot_files_root_path is the path to the directory containing the LCOW + // kernel and root FS files. + string boot_files_root_path = 7; +} + +// ProcessDetails contains additional information about a process. This is the additional +// info returned in the Pids query. +message ProcessDetails { + string image_name = 1; + google.protobuf.Timestamp created_at = 2 [(gogoproto.stdtime) = true, (gogoproto.nullable) = false]; + uint64 kernel_time_100_ns = 3; + uint64 memory_commit_bytes = 4; + uint64 memory_working_set_private_bytes = 5; + uint64 memory_working_set_shared_bytes = 6; + uint32 process_id = 7; + uint64 user_time_100_ns = 8; + string exec_id = 9; +} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c31544..53c0a3854a 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 0000000000..42540f7e50 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,39 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/docker/distribution v2.7.1+incompatible // indirect + github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c // indirect + github.com/gogo/googleapis v1.2.0 // indirect + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/image-spec v1.0.1 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.0.0-20190207185410-29686dbc5559 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 0000000000..2e5291fdad --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,142 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= +github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v0.0.0-20190214164719-faec567304bb h1:TeJqRxMMwB7ex9yxtnc18AV+vVnjMePVQEhT6cQFhUU= +github.com/containerd/containerd v0.0.0-20190214164719-faec567304bb/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.2.8 h1:oM84oDW6+A0FQ4aWW5wnnexazvrQA5Hw6iXAi4rczWw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190826204247-d618c80077fe h1:rqBP1w6ViOtCCAFKMerm0U9e/hEmTrJXStmQph9YbOQ= +github.com/containerd/containerd v1.3.0-beta.2.0.20190826204247-d618c80077fe/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20180920185216-2a805f718635 h1:Hh9KYLzbpTyhtCnW4p0Iy+bJNO4fGKFZp1ylELZw6TI= +github.com/containerd/ttrpc v0.0.0-20180920185216-2a805f718635/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20190613183316-1fb3814edf44 h1:vG5QXCUakUhR2CRI44aD3joCWcvb5mfZRxcwVqBVGeU= +github.com/containerd/ttrpc v0.0.0-20190613183316-1fb3814edf44/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20190826154248-f969a7f076a2 h1:uR0Zz83OrfOhXWwDdwVYirFZI/LMdZXMzCHzfnQFO9w= +github.com/containerd/ttrpc v0.0.0-20190826154248-f969a7f076a2/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug= +github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c h1:+pKlWGMw7gf6bQ+oDZB4KHQFypsfjYlq/C4rfL7D3g8= +github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA= +github.com/gogo/googleapis v1.2.0 h1:Z0v3OJDotX9ZBpdz2V+AI7F4fITSZhVE5mg6GQppwMM= +github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= +github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.0.0-20190207185410-29686dbc5559 h1:pVIiB5BBYCSqbku9gTus5uZ+dmmZiWtmHAaI8Y1hpb4= +github.com/opencontainers/runtime-spec v0.0.0-20190207185410-29686dbc5559/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go index 8bae5fc0ee..da741449b8 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go @@ -7,7 +7,7 @@ import ( "fmt" "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) //go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go hcn.go diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go index d58335e5c6..e02146f8ca 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go @@ -2,8 +2,9 @@ package hcn import ( "encoding/json" + "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -121,7 +122,10 @@ func enumerateEndpoints(query string) ([]HostComputeEndpoint, error) { } func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndpoint, error) { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } // Open network. var networkHandle hcnNetwork var resultBuffer *uint16 @@ -167,7 +171,10 @@ func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndp } func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, error) { - endpointGuid := guid.FromString(endpointId) + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return nil, errInvalidEndpointID + } // Open endpoint var ( endpointHandle hcnEndpoint @@ -208,7 +215,10 @@ func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, e } func deleteEndpoint(endpointId string) error { - endpointGuid := guid.FromString(endpointId) + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return errInvalidEndpointID + } var resultBuffer *uint16 hr := hcnDeleteEndpoint(&endpointGuid, &resultBuffer) if err := checkForErrors("hcnDeleteEndpoint", hr, resultBuffer); err != nil { @@ -299,6 +309,10 @@ func GetEndpointByName(endpointName string) (*HostComputeEndpoint, error) { func (endpoint *HostComputeEndpoint) Create() (*HostComputeEndpoint, error) { logrus.Debugf("hcn::HostComputeEndpoint::Create id=%s", endpoint.Id) + if endpoint.HostComputeNamespace != "" { + return nil, errors.New("endpoint create error, endpoint json HostComputeNamespace is read only and should not be set") + } + jsonString, err := json.Marshal(endpoint) if err != nil { return nil, err @@ -339,7 +353,7 @@ func ModifyEndpointSettings(endpointId string, request *ModifyEndpointSettingReq } // ApplyPolicy applies a Policy (ex: ACL) on the Endpoint. -func (endpoint *HostComputeEndpoint) ApplyPolicy(endpointPolicy PolicyEndpointRequest) error { +func (endpoint *HostComputeEndpoint) ApplyPolicy(requestType RequestType, endpointPolicy PolicyEndpointRequest) error { logrus.Debugf("hcn::HostComputeEndpoint::ApplyPolicy id=%s", endpoint.Id) settingsJson, err := json.Marshal(endpointPolicy) @@ -348,7 +362,7 @@ func (endpoint *HostComputeEndpoint) ApplyPolicy(endpointPolicy PolicyEndpointRe } requestMessage := &ModifyEndpointSettingRequest{ ResourceType: EndpointResourceTypePolicy, - RequestType: RequestTypeUpdate, + RequestType: requestType, Settings: settingsJson, } diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go index 6d46bf8bbc..dd029502ee 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go @@ -3,13 +3,22 @@ package hcn import ( + "errors" "fmt" + "github.com/Microsoft/hcsshim/internal/hcs" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) +var ( + errInvalidNetworkID = errors.New("invalid network ID") + errInvalidEndpointID = errors.New("invalid endpoint ID") + errInvalidNamespaceID = errors.New("invalid namespace ID") + errInvalidLoadBalancerID = errors.New("invalid load balancer ID") +) + func checkForErrors(methodName string, hr error, resultBuffer *uint16) error { errorFound := false @@ -81,7 +90,7 @@ func (e LoadBalancerNotFoundError) Error() string { // IsNotFoundError returns a boolean indicating whether the error was caused by // a resource not being found. func IsNotFoundError(err error) bool { - switch err.(type) { + switch pe := err.(type) { case NetworkNotFoundError: return true case EndpointNotFoundError: @@ -90,6 +99,8 @@ func IsNotFoundError(err error) bool { return true case LoadBalancerNotFoundError: return true + case *hcserror.HcsError: + return pe.Err == hcs.ErrElementNotFound } return false } diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go index 29d13deac9..5ac0ed5659 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go @@ -24,7 +24,7 @@ var ( // HNSVersion1803 added ACL functionality. HNSVersion1803 = Version{Major: 7, Minor: 2} // V2ApiSupport allows the use of V2 Api calls and V2 Schema. - V2ApiSupport = Version{Major: 9, Minor: 1} + V2ApiSupport = Version{Major: 9, Minor: 2} // Remote Subnet allows for Remote Subnet policies on Overlay networks RemoteSubnetVersion = Version{Major: 9, Minor: 2} // A Host Route policy allows for local container to local host communication Overlay networks diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go index cff68e1350..898e02a801 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go @@ -3,7 +3,7 @@ package hcn import ( "encoding/json" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -148,7 +148,10 @@ func createLoadBalancer(settings string) (*HostComputeLoadBalancer, error) { } func modifyLoadBalancer(loadBalancerId string, settings string) (*HostComputeLoadBalancer, error) { - loadBalancerGuid := guid.FromString(loadBalancerId) + loadBalancerGuid, err := guid.FromString(loadBalancerId) + if err != nil { + return nil, errInvalidLoadBalancerID + } // Open loadBalancer. var ( loadBalancerHandle hcnLoadBalancer @@ -189,7 +192,10 @@ func modifyLoadBalancer(loadBalancerId string, settings string) (*HostComputeLoa } func deleteLoadBalancer(loadBalancerId string) error { - loadBalancerGuid := guid.FromString(loadBalancerId) + loadBalancerGuid, err := guid.FromString(loadBalancerId) + if err != nil { + return errInvalidLoadBalancerID + } var resultBuffer *uint16 hr := hcnDeleteLoadBalancer(&loadBalancerGuid, &resultBuffer) if err := checkForErrors("hcnDeleteLoadBalancer", hr, resultBuffer); err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go index 6dbef4f254..f99ff8754c 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go @@ -5,8 +5,8 @@ import ( "os" "syscall" + "github.com/Microsoft/go-winio/pkg/guid" icni "github.com/Microsoft/hcsshim/internal/cni" - "github.com/Microsoft/hcsshim/internal/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/regstate" "github.com/Microsoft/hcsshim/internal/runhcs" @@ -165,7 +165,10 @@ func createNamespace(settings string) (*HostComputeNamespace, error) { } func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace, error) { - namespaceGuid := guid.FromString(namespaceId) + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return nil, errInvalidNamespaceID + } // Open namespace. var ( namespaceHandle hcnNamespace @@ -206,7 +209,10 @@ func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace } func deleteNamespace(namespaceId string) error { - namespaceGuid := guid.FromString(namespaceId) + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return errInvalidNamespaceID + } var resultBuffer *uint16 hr := hcnDeleteNamespace(&namespaceGuid, &resultBuffer) if err := checkForErrors("hcnDeleteNamespace", hr, resultBuffer); err != nil { @@ -241,7 +247,11 @@ func ListNamespacesQuery(query HostComputeQuery) ([]HostComputeNamespace, error) // GetNamespaceByID returns the Namespace specified by Id. func GetNamespaceByID(namespaceId string) (*HostComputeNamespace, error) { - return getNamespace(guid.FromString(namespaceId), defaultQueryJson()) + g, err := guid.FromString(namespaceId) + if err != nil { + return nil, errInvalidNamespaceID + } + return getNamespace(g, defaultQueryJson()) } // GetNamespaceEndpointIds returns the endpoints of the Namespace specified by Id. diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go index b5f1db8b22..a95fc1d751 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go @@ -2,8 +2,9 @@ package hcn import ( "encoding/json" + "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -132,6 +133,12 @@ func getNetwork(networkGuid guid.GUID, query string) (*HostComputeNetwork, error } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -196,6 +203,12 @@ func createNetwork(settings string) (*HostComputeNetwork, error) { } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -203,7 +216,10 @@ func createNetwork(settings string) (*HostComputeNetwork, error) { } func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, error) { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } // Open Network var ( networkHandle hcnNetwork @@ -237,6 +253,12 @@ func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, erro } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -244,7 +266,10 @@ func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, erro } func deleteNetwork(networkId string) error { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return errInvalidNetworkID + } var resultBuffer *uint16 hr := hcnDeleteNetwork(&networkGuid, &resultBuffer) if err := checkForErrors("hcnDeleteNetwork", hr, resultBuffer); err != nil { @@ -320,6 +345,24 @@ func GetNetworkByName(networkName string) (*HostComputeNetwork, error) { // Create Network. func (network *HostComputeNetwork) Create() (*HostComputeNetwork, error) { logrus.Debugf("hcn::HostComputeNetwork::Create id=%s", network.Id) + for _, ipam := range network.Ipams { + for _, subnet := range ipam.Subnets { + if subnet.IpAddressPrefix != "" { + hasDefault := false + for _, route := range subnet.Routes { + if route.NextHop == "" { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + if route.DestinationPrefix == "0.0.0.0/0" || route.DestinationPrefix == "::/0" { + hasDefault = true + } + } + if !hasDefault { + return nil, errors.New("network create error, no default gateway") + } + } + } + } jsonString, err := json.Marshal(network) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go index 6b12d73c60..d05398f254 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go @@ -1,6 +1,8 @@ package hcn -import "encoding/json" +import ( + "encoding/json" +) // EndpointPolicyType are the potential Policies that apply to Endpoints. type EndpointPolicyType string @@ -64,14 +66,18 @@ type SubnetPolicy struct { Settings json.RawMessage `json:",omitempty"` } +// NatFlags are flags for portmappings. +type NatFlags uint32 + /// Endpoint Policy objects // PortMappingPolicySetting defines Port Mapping (NAT) type PortMappingPolicySetting struct { - Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 - InternalPort uint16 `json:",omitempty"` - ExternalPort uint16 `json:",omitempty"` - VIP string `json:",omitempty"` + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + VIP string `json:",omitempty"` + Flags NatFlags `json:",omitempty"` } // ActionType associated with ACLs. Value is either Allow or Block. @@ -131,6 +137,26 @@ type SDNRoutePolicySetting struct { NeedEncap bool `json:",omitempty"` } +// A ProxyType is a type of proxy used by the L4 proxy policy. +type ProxyType int + +const ( + // ProxyTypeVFP specifies a Virtual Filtering Protocol proxy. + ProxyTypeVFP ProxyType = iota + // ProxyTypeWFP specifies a Windows Filtering Platform proxy. + ProxyTypeWFP +) + +// FiveTuple is nested in L4ProxyPolicySetting for WFP support. +type FiveTuple struct { + Protocols string `json:",omitempty"` + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:",omitempty"` + RemotePorts string `json:",omitempty"` + Priority uint16 `json:",omitempty"` +} + // L4ProxyPolicySetting sets Layer-4 Proxy on an endpoint. type L4ProxyPolicySetting struct { IP string `json:",omitempty"` @@ -139,6 +165,12 @@ type L4ProxyPolicySetting struct { ExceptionList []string `json:",omitempty"` Destination string `json:","` OutboundNat bool `json:",omitempty"` + + // For the WFP proxy + FilterTuple FiveTuple `json:",omitempty"` + ProxyType ProxyType `json:",omitempty"` + UserSID string `json:",omitempty"` + CompartmentID uint32 `json:",omitempty"` } // PortnameEndpointPolicySetting sets the port name for an endpoint. diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c42..09b3860a7b 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go index 842ee1f7af..4a4fcea843 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go @@ -3,7 +3,7 @@ package cni import ( "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/regstate" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 0000000000..c0158269f0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,80 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef1..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c0306..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4bb..62ba81751b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b565353..9a4705a494 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf1..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a22..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf99..d366f629f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) + if err != nil { + err = makeProcessError(process, operation, err, events) + } + return delivered, err +} + +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) }) - events := processHcsResult(resultp) - if err != nil { - return makeProcessError(process, operation, err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil -} - -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) - } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b242524d..f7d4ba87a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,23 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +43,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, + waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +82,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() - - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +197,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +240,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +254,358 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) + } + return nil +} + +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) - if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) - } - - return nil -} - -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Properties" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") - - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, - } +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() + + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +613,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +630,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c574..f07f532c13 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed31874..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c3..6a1c41e159 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263b..2df4a57f56 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de912..b7ae96fddd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029ec..922f7c679e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 0000000000..ba6b1a4a53 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 0000000000..f428bdaf72 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 0000000000..fee4765cbc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go index 3015c3640e..2f39e5845a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go @@ -10,7 +10,7 @@ import ( "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // ContainerState represents the platform agnostic pieces relating to a diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace6..fb23617f54 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc21..bcfeb34d54 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab6..c1ea3953b5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a7..b4f9c315b0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5a..8bf8cab60e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d2858..10cea67e04 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d95..1d5dfe68ad 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe55..68aa04a573 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc7..4fb2310768 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e213..1fd7ca5d56 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571d..781a884015 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f711..85450c41e1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe40..fe86cab655 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa767352..af82800483 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3f..8838519a39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c51..ea3084bca7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd9..23b2ee9e7d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c15..a017691f02 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12c..176c49d495 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b8..9b86a40457 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a9..208074e9a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a4..ec93d004e1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd8..b2c2a05a0c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,7 +10,6 @@ package hcsschema type MemoryInformationForVm struct { - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f69..625bc8bbef 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,7 +11,6 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c25..a9c750b341 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c5..e5ea187a29 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d1790..d96c9501f3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2c..21707a88eb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1f..29d8c8012f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817a6..41f8fdea02 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8fe..e9a662dd59 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d00..e4ed095c7b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734e..82b0d0532b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d1503..ad9a4fa9ad 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245a..bb24e88da1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356d..21fe46062b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e572..41f83a5458 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,7 +11,6 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f66..ac7f870007 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -10,7 +10,6 @@ package hcsschema type Properties struct { - Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdfd..877e13503e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - PropertyTypes []string `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e4531283..8d5f5c1719 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc80..006906f6e2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60b..26fde99c74 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f48413..3f203176c3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd4..df9baa9219 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba73..825b71865d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7da..f67b08eb57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8aa..5eaf6a7f4a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b5..aedcd1c16c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,7 +15,6 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1e..9c5e6eb532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d75..092ed6605f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,7 +11,6 @@ package hcsschema // Storage runtime statistics type StorageStats struct { - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c8234..8348699403 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f96..0e48ece500 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bcf..3ab409d825 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12a..2abfccca31 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e56062..ec5d0fb936 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ecb..91a3c83d4f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444aa..70cf2d90de 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a71..362df363e1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a423..915e9b6386 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279dc..75196bd8c8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667c..6a09c03109 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,7 +10,6 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc83..8ed7e566d6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 0000000000..9e4f9d42bc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,563 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87f..0f2a69f6ad 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedce..443596fbaa 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a074..06671309d1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65f..a259c1b828 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8c..04cb4e7ab4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbde..f60ba55010 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go similarity index 88% rename from vendor/github.com/Microsoft/hcsshim/osversion/osversion.go rename to vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 916950c023..477fe70783 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -46,6 +46,12 @@ func Get() OSVersion { return osv } +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 2d9567f6f0..3488cc451a 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,10 +1,27 @@ package osversion const ( - - // RS2 was a client-only release in case you're asking why it's not in the list. + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Sever 1903 (semi-annual + // channel). + V19H1 = 18362 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c2..3362c68335 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed15662..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb \ No newline at end of file diff --git a/vendor/github.com/syndtr/gocapability/capability/capability_linux.go b/vendor/github.com/syndtr/gocapability/capability/capability_linux.go index 6d2135ac58..205e0f7013 100644 --- a/vendor/github.com/syndtr/gocapability/capability/capability_linux.go +++ b/vendor/github.com/syndtr/gocapability/capability/capability_linux.go @@ -428,11 +428,11 @@ func (c *capsV3) Load() (err error) { } if strings.HasPrefix(line, "CapB") { fmt.Sscanf(line[4:], "nd: %08x%08x", &c.bounds[1], &c.bounds[0]) - break + continue } if strings.HasPrefix(line, "CapA") { fmt.Sscanf(line[4:], "mb: %08x%08x", &c.ambient[1], &c.ambient[0]) - break + continue } } f.Close() diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md index 3f40ed5cbb..fabab2e060 100644 --- a/vendor/go.opencensus.io/README.md +++ b/vendor/go.opencensus.io/README.md @@ -253,10 +253,10 @@ release in which the functionality was marked *Deprecated*. [new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap [new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace -[exporter-prom]: https://godoc.org/go.opencensus.io/exporter/prometheus +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus [exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver -[exporter-zipkin]: https://godoc.org/go.opencensus.io/exporter/zipkin -[exporter-jaeger]: https://godoc.org/go.opencensus.io/exporter/jaeger +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger [exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws [exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog [exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod index 8b7d38e91b..cb4de80f3b 100644 --- a/vendor/go.opencensus.io/go.mod +++ b/vendor/go.opencensus.io/go.mod @@ -1,10 +1,12 @@ module go.opencensus.io require ( - github.com/golang/protobuf v1.2.0 - github.com/google/go-cmp v0.2.0 - github.com/hashicorp/golang-lru v0.5.0 - golang.org/x/net v0.0.0-20190311183353-d8887717615a - google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19 // indirect - google.golang.org/grpc v1.19.0 + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 ) diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum index cbb37036d4..0b948c2b40 100644 --- a/vendor/go.opencensus.io/go.sum +++ b/vendor/go.opencensus.io/go.sum @@ -6,21 +6,24 @@ github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfU github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ= -github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= -github.com/hashicorp/golang-lru v0.5.0 h1:CL2msUPvZTLb5O648aiLNJw3hnBxN2+1Jq8rCOH9wdo= -github.com/hashicorp/golang-lru v0.5.0 h1:CL2msUPvZTLb5O648aiLNJw3hnBxN2+1Jq8rCOH9wdo= -github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= -github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= @@ -31,20 +34,28 @@ golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= -google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19 h1:Lj2SnHtxkRGJDqnGaSjo+CCdIieEnwVazbOXILwQemk= -google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go index d2565f1e2b..626d73645d 100644 --- a/vendor/go.opencensus.io/opencensus.go +++ b/vendor/go.opencensus.io/opencensus.go @@ -17,5 +17,5 @@ package opencensus // import "go.opencensus.io" // Version is the current release version of OpenCensus in use. func Version() string { - return "0.21.0" + return "0.22.0" } diff --git a/vendor/go.opencensus.io/stats/view/view_to_metric.go b/vendor/go.opencensus.io/stats/view/view_to_metric.go index 010f81bab5..f67b5c4643 100644 --- a/vendor/go.opencensus.io/stats/view/view_to_metric.go +++ b/vendor/go.opencensus.io/stats/view/view_to_metric.go @@ -73,7 +73,7 @@ func getType(v *View) metricdata.Type { } } -func getLableKeys(v *View) []metricdata.LabelKey { +func getLabelKeys(v *View) []metricdata.LabelKey { labelKeys := []metricdata.LabelKey{} for _, k := range v.TagKeys { labelKeys = append(labelKeys, metricdata.LabelKey{Key: k.Name()}) @@ -87,7 +87,7 @@ func viewToMetricDescriptor(v *View) *metricdata.Descriptor { Description: v.Description, Unit: getUnit(v.Measure.Unit()), Type: getType(v), - LabelKeys: getLableKeys(v), + LabelKeys: getLabelKeys(v), } } diff --git a/vendor/go.opencensus.io/tag/key.go b/vendor/go.opencensus.io/tag/key.go index ebbed95000..4e63d08c93 100644 --- a/vendor/go.opencensus.io/tag/key.go +++ b/vendor/go.opencensus.io/tag/key.go @@ -29,6 +29,16 @@ func NewKey(name string) (Key, error) { return Key{name: name}, nil } +// MustNewKey creates or retrieves a string key identified by name. +// An invalid key name raises a panic. +func MustNewKey(name string) Key { + k, err := NewKey(name) + if err != nil { + panic(err) + } + return k +} + // Name returns the name of the key. func (k Key) Name() string { return k.name diff --git a/vendor/golang.org/x/sys/cpu/byteorder.go b/vendor/golang.org/x/sys/cpu/byteorder.go index da6b9e4363..ed8da8deac 100644 --- a/vendor/golang.org/x/sys/cpu/byteorder.go +++ b/vendor/golang.org/x/sys/cpu/byteorder.go @@ -5,26 +5,56 @@ package cpu import ( - "encoding/binary" "runtime" ) +// byteOrder is a subset of encoding/binary.ByteOrder. +type byteOrder interface { + Uint32([]byte) uint32 + Uint64([]byte) uint64 +} + +type littleEndian struct{} +type bigEndian struct{} + +func (littleEndian) Uint32(b []byte) uint32 { + _ = b[3] // bounds check hint to compiler; see golang.org/issue/14808 + return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 +} + +func (littleEndian) Uint64(b []byte) uint64 { + _ = b[7] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | + uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 +} + +func (bigEndian) Uint32(b []byte) uint32 { + _ = b[3] // bounds check hint to compiler; see golang.org/issue/14808 + return uint32(b[3]) | uint32(b[2])<<8 | uint32(b[1])<<16 | uint32(b[0])<<24 +} + +func (bigEndian) Uint64(b []byte) uint64 { + _ = b[7] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[7]) | uint64(b[6])<<8 | uint64(b[5])<<16 | uint64(b[4])<<24 | + uint64(b[3])<<32 | uint64(b[2])<<40 | uint64(b[1])<<48 | uint64(b[0])<<56 +} + // hostByteOrder returns binary.LittleEndian on little-endian machines and // binary.BigEndian on big-endian machines. -func hostByteOrder() binary.ByteOrder { +func hostByteOrder() byteOrder { switch runtime.GOARCH { case "386", "amd64", "amd64p32", "arm", "arm64", "mipsle", "mips64le", "mips64p32le", "ppc64le", "riscv", "riscv64": - return binary.LittleEndian + return littleEndian{} case "armbe", "arm64be", "mips", "mips64", "mips64p32", "ppc", "ppc64", "s390", "s390x", "sparc", "sparc64": - return binary.BigEndian + return bigEndian{} } panic("unknown architecture") } diff --git a/vendor/golang.org/x/sys/cpu/cpu_linux.go b/vendor/golang.org/x/sys/cpu/cpu_linux.go index 76b5f507fa..10e712dc5d 100644 --- a/vendor/golang.org/x/sys/cpu/cpu_linux.go +++ b/vendor/golang.org/x/sys/cpu/cpu_linux.go @@ -2,7 +2,7 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -//+build !amd64,!amd64p32,!386 +// +build !amd64,!amd64p32,!386 package cpu diff --git a/vendor/golang.org/x/sys/unix/affinity_linux.go b/vendor/golang.org/x/sys/unix/affinity_linux.go index 14e4d5caa3..6e5c81acd0 100644 --- a/vendor/golang.org/x/sys/unix/affinity_linux.go +++ b/vendor/golang.org/x/sys/unix/affinity_linux.go @@ -7,6 +7,7 @@ package unix import ( + "math/bits" "unsafe" ) @@ -79,50 +80,7 @@ func (s *CPUSet) IsSet(cpu int) bool { func (s *CPUSet) Count() int { c := 0 for _, b := range s { - c += onesCount64(uint64(b)) + c += bits.OnesCount64(uint64(b)) } return c } - -// onesCount64 is a copy of Go 1.9's math/bits.OnesCount64. -// Once this package can require Go 1.9, we can delete this -// and update the caller to use bits.OnesCount64. -func onesCount64(x uint64) int { - const m0 = 0x5555555555555555 // 01010101 ... - const m1 = 0x3333333333333333 // 00110011 ... - const m2 = 0x0f0f0f0f0f0f0f0f // 00001111 ... - - // Unused in this function, but definitions preserved for - // documentation purposes: - // - // const m3 = 0x00ff00ff00ff00ff // etc. - // const m4 = 0x0000ffff0000ffff - // - // Implementation: Parallel summing of adjacent bits. - // See "Hacker's Delight", Chap. 5: Counting Bits. - // The following pattern shows the general approach: - // - // x = x>>1&(m0&m) + x&(m0&m) - // x = x>>2&(m1&m) + x&(m1&m) - // x = x>>4&(m2&m) + x&(m2&m) - // x = x>>8&(m3&m) + x&(m3&m) - // x = x>>16&(m4&m) + x&(m4&m) - // x = x>>32&(m5&m) + x&(m5&m) - // return int(x) - // - // Masking (& operations) can be left away when there's no - // danger that a field's sum will carry over into the next - // field: Since the result cannot be > 64, 8 bits is enough - // and we can ignore the masks for the shifts by 8 and up. - // Per "Hacker's Delight", the first line can be simplified - // more, but it saves at best one instruction, so we leave - // it alone for clarity. - const m = 1<<64 - 1 - x = x>>1&(m0&m) + x&(m0&m) - x = x>>2&(m1&m) + x&(m1&m) - x = (x>>4 + x) & (m2 & m) - x += x >> 8 - x += x >> 16 - x += x >> 32 - return int(x) & (1<<7 - 1) -} diff --git a/vendor/golang.org/x/sys/unix/ioctl.go b/vendor/golang.org/x/sys/unix/ioctl.go index f121a8d64b..3559e5dcb2 100644 --- a/vendor/golang.org/x/sys/unix/ioctl.go +++ b/vendor/golang.org/x/sys/unix/ioctl.go @@ -6,7 +6,19 @@ package unix -import "runtime" +import ( + "runtime" + "unsafe" +) + +// ioctl itself should not be exposed directly, but additional get/set +// functions for specific types are permissible. + +// IoctlSetInt performs an ioctl operation which sets an integer value +// on fd, using the specified request number. +func IoctlSetInt(fd int, req uint, value int) error { + return ioctl(fd, req, uintptr(value)) +} // IoctlSetWinsize performs an ioctl on fd with a *Winsize argument. // @@ -14,7 +26,7 @@ import "runtime" func IoctlSetWinsize(fd int, req uint, value *Winsize) error { // TODO: if we get the chance, remove the req parameter and // hardcode TIOCSWINSZ. - err := ioctlSetWinsize(fd, req, value) + err := ioctl(fd, req, uintptr(unsafe.Pointer(value))) runtime.KeepAlive(value) return err } @@ -24,7 +36,30 @@ func IoctlSetWinsize(fd int, req uint, value *Winsize) error { // The req value will usually be TCSETA or TIOCSETA. func IoctlSetTermios(fd int, req uint, value *Termios) error { // TODO: if we get the chance, remove the req parameter. - err := ioctlSetTermios(fd, req, value) + err := ioctl(fd, req, uintptr(unsafe.Pointer(value))) runtime.KeepAlive(value) return err } + +// IoctlGetInt performs an ioctl operation which gets an integer value +// from fd, using the specified request number. +// +// A few ioctl requests use the return value as an output parameter; +// for those, IoctlRetInt should be used instead of this function. +func IoctlGetInt(fd int, req uint) (int, error) { + var value int + err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) + return value, err +} + +func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { + var value Winsize + err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) + return &value, err +} + +func IoctlGetTermios(fd int, req uint) (*Termios, error) { + var value Termios + err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) + return &value, err +} diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index 14624b9531..8a2dcfa517 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -183,20 +183,26 @@ struct ltchars { #include #include #include +#include #include +#include #include +#include +#include +#include +#include +#include +#include +#include #include +#include #include #include #include #include #include #include -#include -#include -#include -#include -#include +#include #include #include #include @@ -206,26 +212,23 @@ struct ltchars { #include #include #include +#include #include +#include #include #include +#include #include -#include #include #include -#include -#include -#include #include -#include -#include +#include #include -#include +#include +#include +#include #include -#include -#include -#include -#include + #include #include @@ -264,6 +267,11 @@ struct ltchars { #define FS_KEY_DESC_PREFIX "fscrypt:" #define FS_KEY_DESC_PREFIX_SIZE 8 #define FS_MAX_KEY_SIZE 64 + +// The code generator produces -0x1 for (~0), but an unsigned value is necessary +// for the tipc_subscr timeout __u32 field. +#undef TIPC_WAIT_FOREVER +#define TIPC_WAIT_FOREVER 0xffffffff ' includes_NetBSD=' @@ -451,6 +459,7 @@ ccflags="$@" $2 ~ /^SYSCTL_VERS/ || $2 !~ "MNT_BITS" && $2 ~ /^(MS|MNT|UMOUNT)_/ || + $2 ~ /^NS_GET_/ || $2 ~ /^TUN(SET|GET|ATTACH|DETACH)/ || $2 ~ /^(O|F|[ES]?FD|NAME|S|PTRACE|PT)_/ || $2 ~ /^KEXEC_/ || @@ -506,6 +515,7 @@ ccflags="$@" $2 ~ /^XDP_/ || $2 ~ /^(HDIO|WIN|SMART)_/ || $2 ~ /^CRYPTO_/ || + $2 ~ /^TIPC_/ || $2 !~ "WMESGLEN" && $2 ~ /^W[A-Z0-9]+$/ || $2 ~/^PPPIOC/ || diff --git a/vendor/golang.org/x/sys/unix/syscall_aix.go b/vendor/golang.org/x/sys/unix/syscall_aix.go index 1aa065f9c9..9ad8a0d4a5 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix.go @@ -350,49 +350,12 @@ func (w WaitStatus) Signal() Signal { func (w WaitStatus) Continued() bool { return w&0x01000000 != 0 } -func (w WaitStatus) CoreDump() bool { return w&0x200 != 0 } +func (w WaitStatus) CoreDump() bool { return w&0x80 == 0x80 } func (w WaitStatus) TrapCause() int { return -1 } //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - // fcntl must never be called with cmd=F_DUP2FD because it doesn't work on AIX // There is no way to create a custom fcntl and to keep //sys fcntl easily, // Therefore, the programmer must call dup2 instead of fcntl in this case. diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go index bf05603f15..b3c8e3301c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go index 13d4321f4c..9a6e024179 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index 97a8eef6fa..3e6671426c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -413,8 +413,6 @@ func Kevent(kq int, changes, events []Kevent_t, timeout *Timespec) (n int, err e return kevent(kq, change, len(changes), event, len(events), timeout) } -//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL - // sysctlmib translates name to mib number and appends any additional args. func sysctlmib(name string, args ...int) ([]_C_int, error) { // Translate name to mib number. diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin.go b/vendor/golang.org/x/sys/unix/syscall_darwin.go index 216b4ac9e8..f26a19ebd6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin.go @@ -89,7 +89,6 @@ func direntNamlen(buf []byte) (uint64, bool) { return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) } -//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) func PtraceAttach(pid int) (err error) { return ptrace(PT_ATTACH, pid, 0, 0) } func PtraceDetach(pid int) (err error) { return ptrace(PT_DETACH, pid, 0, 0) } @@ -340,43 +339,6 @@ func Kill(pid int, signum syscall.Signal) (err error) { return kill(pid, int(sig //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func Uname(uname *Utsname) error { mib := []_C_int{CTL_KERN, KERN_OSTYPE} n := unsafe.Sizeof(uname.Sysname) diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go index 489726fa9b..cf1bec6a3b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go @@ -10,6 +10,9 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL +//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } @@ -43,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go index 914b89bde5..5867ed00b6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go @@ -10,6 +10,9 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL +//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } @@ -43,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go index 4a284cf502..e199e12a5d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go @@ -8,6 +8,14 @@ import ( "syscall" ) +func ptrace(request int, pid int, addr uintptr, data uintptr) error { + return ENOTSUP +} + +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } @@ -41,6 +49,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go index 52dcd88f6b..2c50ca9015 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go @@ -10,6 +10,14 @@ import ( "syscall" ) +func ptrace(request int, pid int, addr uintptr, data uintptr) error { + return ENOTSUP +} + +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } @@ -43,6 +51,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go index 260a400f91..99d8756249 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go @@ -14,6 +14,8 @@ package unix import "unsafe" +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 @@ -150,43 +152,6 @@ func setattrlistTimes(path string, times []Timespec, flags int) error { //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func sysctlUname(mib []_C_int, old *byte, oldlen *uintptr) error { err := sysctl(mib, old, oldlen, nil, 0) if err != nil { diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go index 9babb31ea7..a6b4830ac8 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index 329d240b90..b62231bca2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -36,6 +36,8 @@ var ( // INO64_FIRST from /usr/src/lib/libc/sys/compat-ino64.h const _ino64First = 1200031 +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + func supportsABI(ver uint32) bool { osreldateOnce.Do(func() { osreldate, _ = SysctlUint32("kern.osreldate") }) return osreldate >= ver @@ -201,43 +203,6 @@ func setattrlistTimes(path string, times []Timespec, flags int) error { //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func Uname(uname *Utsname) error { mib := []_C_int{CTL_KERN, KERN_OSTYPE} n := unsafe.Sizeof(uname.Sysname) diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go index 21e03958cd..dcc56457a0 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go index 9c945a6579..321c3baceb 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go index 5cd6243f2a..6977008313 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go index a318054878..dbbbfd6035 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index 637b5017b8..e538bb5677 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -71,6 +71,17 @@ func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { // ioctl itself should not be exposed directly, but additional get/set // functions for specific types are permissible. +// IoctlRetInt performs an ioctl operation specified by req on a device +// associated with opened file descriptor fd, and returns a non-negative +// integer that is returned by the ioctl syscall. +func IoctlRetInt(fd int, req uint) (int, error) { + ret, _, err := Syscall(SYS_IOCTL, uintptr(fd), uintptr(req), 0) + if err != 0 { + return 0, err + } + return int(ret), nil +} + // IoctlSetPointerInt performs an ioctl operation which sets an // integer value on fd, using the specified request number. The ioctl // argument is called with a pointer to the integer value, rather than @@ -80,52 +91,18 @@ func IoctlSetPointerInt(fd int, req uint, value int) error { return ioctl(fd, req, uintptr(unsafe.Pointer(&v))) } -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - func IoctlSetRTCTime(fd int, value *RTCTime) error { err := ioctl(fd, RTC_SET_TIME, uintptr(unsafe.Pointer(value))) runtime.KeepAlive(value) return err } -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - func IoctlGetUint32(fd int, req uint) (uint32, error) { var value uint32 err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) return value, err } -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func IoctlGetRTCTime(fd int) (*RTCTime, error) { var value RTCTime err := ioctl(fd, RTC_RD_TIME, uintptr(unsafe.Pointer(&value))) @@ -798,6 +775,70 @@ func (sa *SockaddrPPPoE) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrPPPoX, nil } +// SockaddrTIPC implements the Sockaddr interface for AF_TIPC type sockets. +// For more information on TIPC, see: http://tipc.sourceforge.net/. +type SockaddrTIPC struct { + // Scope is the publication scopes when binding service/service range. + // Should be set to TIPC_CLUSTER_SCOPE or TIPC_NODE_SCOPE. + Scope int + + // Addr is the type of address used to manipulate a socket. Addr must be + // one of: + // - *TIPCSocketAddr: "id" variant in the C addr union + // - *TIPCServiceRange: "nameseq" variant in the C addr union + // - *TIPCServiceName: "name" variant in the C addr union + // + // If nil, EINVAL will be returned when the structure is used. + Addr TIPCAddr + + raw RawSockaddrTIPC +} + +// TIPCAddr is implemented by types that can be used as an address for +// SockaddrTIPC. It is only implemented by *TIPCSocketAddr, *TIPCServiceRange, +// and *TIPCServiceName. +type TIPCAddr interface { + tipcAddrtype() uint8 + tipcAddr() [12]byte +} + +func (sa *TIPCSocketAddr) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCSocketAddr{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCSocketAddr) tipcAddrtype() uint8 { return TIPC_SOCKET_ADDR } + +func (sa *TIPCServiceRange) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceRange{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceRange) tipcAddrtype() uint8 { return TIPC_SERVICE_RANGE } + +func (sa *TIPCServiceName) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceName{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceName) tipcAddrtype() uint8 { return TIPC_SERVICE_ADDR } + +func (sa *SockaddrTIPC) sockaddr() (unsafe.Pointer, _Socklen, error) { + if sa.Addr == nil { + return nil, 0, EINVAL + } + + sa.raw.Family = AF_TIPC + sa.raw.Scope = int8(sa.Scope) + sa.raw.Addrtype = sa.Addr.tipcAddrtype() + sa.raw.Addr = sa.Addr.tipcAddr() + + return unsafe.Pointer(&sa.raw), SizeofSockaddrTIPC, nil +} + func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_NETLINK: @@ -923,6 +964,27 @@ func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { break } } + return sa, nil + case AF_TIPC: + pp := (*RawSockaddrTIPC)(unsafe.Pointer(rsa)) + + sa := &SockaddrTIPC{ + Scope: int(pp.Scope), + } + + // Determine which union variant is present in pp.Addr by checking + // pp.Addrtype. + switch pp.Addrtype { + case TIPC_SERVICE_RANGE: + sa.Addr = (*TIPCServiceRange)(unsafe.Pointer(&pp.Addr)) + case TIPC_SERVICE_ADDR: + sa.Addr = (*TIPCServiceName)(unsafe.Pointer(&pp.Addr)) + case TIPC_SOCKET_ADDR: + sa.Addr = (*TIPCSocketAddr)(unsafe.Pointer(&pp.Addr)) + default: + return nil, EINVAL + } + return sa, nil } return nil, EAFNOSUPPORT diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_386.go index e2f8cf6e5a..e7fa665e68 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_386.go @@ -372,6 +372,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go index 87a30744d6..088ce0f935 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go @@ -163,6 +163,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go index f626794439..11930fc8fa 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go @@ -252,6 +252,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go index cb20b15d5d..251e2d9715 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go @@ -180,6 +180,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go index b3b21ec1e2..7562fe97b8 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go @@ -208,6 +208,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go index 5144d4e133..a939ff8f21 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go @@ -220,6 +220,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go index 0a100b66a3..28d6d0f229 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go @@ -91,6 +91,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go index 6230f64052..6798c26258 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go @@ -179,6 +179,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go index f81dbdc9c8..eb5cb1a71d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go @@ -120,6 +120,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go index b69565616f..37321c12ef 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go @@ -107,6 +107,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index 5ef3090401..3e3f075076 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 @@ -187,43 +189,6 @@ func setattrlistTimes(path string, times []Timespec, flags int) error { //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func IoctlGetPtmget(fd int, req uint) (*Ptmget, error) { var value Ptmget err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go index 24f74e58ce..24da8b5245 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go index 6878bf7ff9..25a0ac8258 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go index dbbfcf71db..21591ecd4d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go index f3434465a1..8047496350 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index 1a074b2fe1..035c043a7c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 @@ -178,43 +180,6 @@ func setattrlistTimes(path string, times []Timespec, flags int) error { //sys ioctl(fd int, req uint, arg uintptr) (err error) -// ioctl itself should not be exposed directly, but additional get/set -// functions for specific types are permissible. - -// IoctlSetInt performs an ioctl operation which sets an integer value -// on fd, using the specified request number. -func IoctlSetInt(fd int, req uint, value int) error { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) error { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -// IoctlGetInt performs an ioctl operation which gets an integer value -// from fd, using the specified request number. -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - //sys ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) func Ppoll(fds []PollFd, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go index d62da60d1f..42b5a0e51e 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go index 9a35334cba..6ea4b48831 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go index 5d812aaea5..1c3d26fa2c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go index 0fb39cf5eb..a8c458cb03 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris.go b/vendor/golang.org/x/sys/unix/syscall_solaris.go index 0153a316dd..1610f551d4 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris.go @@ -553,40 +553,10 @@ func Minor(dev uint64) uint32 { //sys ioctl(fd int, req uint, arg uintptr) (err error) -func IoctlSetInt(fd int, req uint, value int) (err error) { - return ioctl(fd, req, uintptr(value)) -} - -func ioctlSetWinsize(fd int, req uint, value *Winsize) (err error) { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - -func ioctlSetTermios(fd int, req uint, value *Termios) (err error) { - return ioctl(fd, req, uintptr(unsafe.Pointer(value))) -} - func IoctlSetTermio(fd int, req uint, value *Termio) (err error) { return ioctl(fd, req, uintptr(unsafe.Pointer(value))) } -func IoctlGetInt(fd int, req uint) (int, error) { - var value int - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return value, err -} - -func IoctlGetWinsize(fd int, req uint) (*Winsize, error) { - var value Winsize - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - -func IoctlGetTermios(fd int, req uint) (*Termios, error) { - var value Termios - err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) - return &value, err -} - func IoctlGetTermio(fd int, req uint) (*Termio, error) { var value Termio err := ioctl(fd, req, uintptr(unsafe.Pointer(&value))) diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go index 91c32ddf02..b22a34d7ae 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go @@ -18,6 +18,10 @@ func (iov *Iovec) SetLen(length int) { iov.Len = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 5213d820a9..1875f4595a 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -722,6 +726,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -987,6 +992,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1085,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1097,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1406,6 +1425,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1671,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1686,6 +1711,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1724,6 +1750,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1784,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1857,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1881,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1888,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1900,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1908,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1994,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2132,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2432,6 +2468,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2445,7 +2546,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2644,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2660,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 39b630cc51..4af5477da4 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -722,6 +726,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -987,6 +992,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1085,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1097,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1406,6 +1425,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1672,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1687,6 +1712,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1725,6 +1751,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1785,7 +1815,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1858,6 +1888,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1882,6 +1913,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1889,7 +1921,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1901,6 +1933,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1909,8 +1942,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1995,6 +2028,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2133,6 +2168,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2433,6 +2469,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2446,7 +2547,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2644,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2660,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index c59a1beb36..eb2191994b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1690,6 +1715,7 @@ const ( PTRACE_GETSIGMASK = 0x420a PTRACE_GETVFPREGS = 0x1b PTRACE_GETWMMXREGS = 0x12 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x16 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1730,6 +1756,10 @@ const ( PTRACE_SET_SYSCALL = 0x17 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PT_DATA_ADDR = 0x10004 PT_TEXT_ADDR = 0x10000 @@ -1791,7 +1821,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1864,6 +1894,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1888,6 +1919,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1895,7 +1927,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1907,6 +1939,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1915,8 +1948,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2001,6 +2034,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2139,6 +2174,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2439,6 +2475,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2452,7 +2553,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2650,6 +2751,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2666,6 +2769,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index 5f35c19d14..fba8ad48e0 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -561,6 +564,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -724,6 +728,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -989,6 +994,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1087,6 +1093,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1099,6 +1116,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1407,6 +1426,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1672,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1685,6 +1710,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1717,6 +1743,12 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 + PTRACE_SYSEMU = 0x1f + PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1775,7 +1807,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1848,6 +1880,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1872,6 +1905,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1879,7 +1913,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1891,6 +1925,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1899,8 +1934,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1985,6 +2020,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2123,6 +2160,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2424,6 +2462,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2437,7 +2540,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2635,6 +2738,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2651,6 +2756,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index 7f1b7bef28..995a7645a4 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1683,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1726,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1784,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1857,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1881,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1888,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1900,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1908,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1994,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2132,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2434,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2447,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2646,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2662,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index 603d88b8bb..2a38e10340 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1683,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1726,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1784,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1857,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1881,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1888,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1900,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1908,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1994,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2132,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2434,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2447,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2646,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2662,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index ed178f8a72..d1df938315 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1683,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1726,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1784,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1857,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1881,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1888,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1900,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1908,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1994,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2132,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2434,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2447,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2646,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2662,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 080b789335..b92e3a589d 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1683,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1726,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1784,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1857,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1881,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1888,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1900,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1908,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1994,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2132,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2434,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2447,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2646,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2662,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index 961e8eabef..72fd7995fc 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1405,6 +1424,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80000000 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1671,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1690,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1729,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1842,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1915,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1939,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1946,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1958,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1966,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2052,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2190,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2494,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2507,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2705,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2721,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index 6e0538f224..d9d5837ebd 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1405,6 +1424,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80000000 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1671,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1690,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1729,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1842,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1915,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1939,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1946,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1958,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1966,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2052,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2190,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2494,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2507,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2705,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2721,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go index 06c0148c17..11810c85b6 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1669,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1682,6 +1707,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1714,6 +1740,10 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1772,7 +1802,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1845,6 +1875,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1869,6 +1900,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1876,7 +1908,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1888,6 +1920,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1896,8 +1929,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1982,6 +2015,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2120,6 +2155,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2420,6 +2456,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2433,7 +2534,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2631,6 +2732,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2647,6 +2750,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index 39875095c6..70090835c6 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -721,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -986,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1084,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1096,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1404,6 +1423,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0xb703 + NS_GET_OWNER_UID = 0xb704 + NS_GET_PARENT = 0xb702 + NS_GET_USERNS = 0xb701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1671,6 +1694,8 @@ const ( PTRACE_DETACH = 0x11 PTRACE_DISABLE_TE = 0x5010 PTRACE_ENABLE_TE = 0x5009 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1685,6 +1710,7 @@ const ( PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a PTRACE_GET_LAST_BREAK = 0x5006 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1728,6 +1754,10 @@ const ( PTRACE_SINGLEBLOCK = 0xc PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TE_ABORT_RAND = 0x5011 PTRACE_TRACEME = 0x0 PT_ACR0 = 0x90 @@ -1845,7 +1875,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1918,6 +1948,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1942,6 +1973,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1949,7 +1981,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1961,6 +1993,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1969,8 +2002,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2055,6 +2088,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2193,6 +2228,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2493,6 +2529,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2506,7 +2607,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2704,6 +2805,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2720,6 +2823,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index 8d80f99bc0..99b5e165b1 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -256,6 +256,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -307,9 +308,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -463,6 +465,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -564,6 +567,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -725,6 +729,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x1 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -990,6 +995,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1088,6 +1094,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1100,6 +1117,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1408,6 +1427,10 @@ const ( NLM_F_ROOT = 0x100 NOFLSH = 0x80 NSFS_MAGIC = 0x6e736673 + NS_GET_NSTYPE = 0x2000b703 + NS_GET_OWNER_UID = 0x2000b704 + NS_GET_PARENT = 0x2000b702 + NS_GET_USERNS = 0x2000b701 OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 @@ -1673,6 +1696,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1690,6 +1715,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1729,6 +1755,10 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SPARC_DETACH = 0xb PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PTRACE_WRITEDATA = 0x11 PTRACE_WRITETEXT = 0x13 @@ -1837,7 +1867,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1910,6 +1940,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1934,6 +1965,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1941,7 +1973,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1953,6 +1985,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1961,8 +1994,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2047,6 +2080,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2185,6 +2220,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x47 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2482,6 +2518,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x20005437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2495,7 +2596,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2693,6 +2794,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2709,6 +2812,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 __TIOCFLUSH = 0x80047410 ) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go index c4ec7ff87c..dd5ea36ee9 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go @@ -377,16 +377,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -1691,6 +1681,16 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int32, usec int32, err error) { r0, r1, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tp)), 0, 0) sec = int32(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go index 23346dc68f..5ab9a8277a 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -527,21 +506,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -943,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { @@ -2341,6 +2320,42 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_ptrace_trampoline() + +//go:linkname libc_ptrace libc_ptrace +//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int32, usec int32, err error) { r0, r1, e1 := syscall_rawSyscall(funcPC(libc_gettimeofday_trampoline), uintptr(unsafe.Pointer(tp)), 0, 0) sec = int32(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s index 37b85b4f61..c6557b135a 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -64,8 +62,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 @@ -108,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 @@ -264,6 +262,10 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) +TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 + JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 JMP libc_gettimeofday(SB) TEXT ·libc_fstat64_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go index 2581e8960f..985f338884 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -1691,6 +1665,32 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int64, usec int32, err error) { r0, r1, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tp)), 0, 0) sec = int64(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go index c142e33e92..22163ef401 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -527,21 +506,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -2356,6 +2320,42 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_ptrace_trampoline() + +//go:linkname libc_ptrace libc_ptrace +//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int64, usec int32, err error) { r0, r1, e1 := syscall_rawSyscall(funcPC(libc_gettimeofday_trampoline), uintptr(unsafe.Pointer(tp)), 0, 0) sec = int64(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s index 1a3915197d..ad410cfbce 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -64,8 +62,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 @@ -266,6 +262,10 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) +TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 + JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 JMP libc_gettimeofday(SB) TEXT ·libc_fstat64_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go index f8caecef02..0e47deb788 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go index 01cffbf46c..bbc18c4f60 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -527,21 +506,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -943,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s index 994056f359..66af9f480e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s @@ -64,8 +64,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go index 3fd0f3c854..3f4cc0f34d 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go index 8f2691deea..43356c832e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -527,21 +506,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -943,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s index 61dc0d4c12..96ab9877eb 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -64,8 +62,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 @@ -108,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go index e869c06031..7aae554f21 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go @@ -429,4 +429,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go index 4917b8ab6d..7968439a92 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go @@ -351,4 +351,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go index f85fcb4f80..3c663c69d4 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go index 678a119bc9..753def987e 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go @@ -296,4 +296,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go index 222c9f9a2f..ac86bd5446 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go index 28e6d0e9d6..1f5705b588 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go index e643c6f632..d9ed953264 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go index 01d93c420f..94266b65a4 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go index 5744149ebf..52e3da6490 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go index 21c8320428..6141f90a82 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go index c1bb6d8f2d..4f7261a884 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go @@ -295,4 +295,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go index bc3cc6b5b2..f47014ac05 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go @@ -358,4 +358,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go index 0a2841ba8c..dd78abb0d6 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go @@ -373,4 +373,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index 50bc4128ff..d02a183507 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -425,6 +432,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -614,6 +622,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -664,6 +673,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2521,3 +2537,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index 055eaa76a4..f347457e9e 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2535,3 +2551,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index 66019c9cfe..d53d575b85 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -429,6 +436,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -618,6 +626,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -668,6 +677,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2512,3 +2528,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index 3104798c40..aa41189bdf 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2514,3 +2530,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index 46c86021b7..913efd6164 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index c2fe1a62a6..860fb5dae2 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index f1eb0d3979..12138089a3 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 8759bc36b8..2498796fda 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index a812005412..17b83f7587 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index 74b7a9199b..d289725b69 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go index ccea3e6387..7546c13405 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2542,3 +2558,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index d8fc0bc1cd..8907bc74b2 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2538,3 +2554,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index 5e0ab93292..5efa151ebf 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -430,6 +437,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -619,6 +627,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -669,6 +678,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2519,3 +2535,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/windows/security_windows.go b/vendor/golang.org/x/sys/windows/security_windows.go index 61b49647b9..7b2cfb9e0a 100644 --- a/vendor/golang.org/x/sys/windows/security_windows.go +++ b/vendor/golang.org/x/sys/windows/security_windows.go @@ -644,6 +644,8 @@ func (tml *Tokenmandatorylabel) Size() uint32 { //sys DuplicateTokenEx(existingToken Token, desiredAccess uint32, tokenAttributes *SecurityAttributes, impersonationLevel uint32, tokenType uint32, newToken *Token) (err error) = advapi32.DuplicateTokenEx //sys GetUserProfileDirectory(t Token, dir *uint16, dirLen *uint32) (err error) = userenv.GetUserProfileDirectoryW //sys getSystemDirectory(dir *uint16, dirLen uint32) (len uint32, err error) = kernel32.GetSystemDirectoryW +//sys getWindowsDirectory(dir *uint16, dirLen uint32) (len uint32, err error) = kernel32.GetWindowsDirectoryW +//sys getSystemWindowsDirectory(dir *uint16, dirLen uint32) (len uint32, err error) = kernel32.GetSystemWindowsDirectoryW // An access token contains the security information for a logon session. // The system creates an access token when a user logs on, and every @@ -664,7 +666,7 @@ func OpenCurrentProcessToken() (Token, error) { return 0, e } var t Token - e = OpenProcessToken(p, TOKEN_QUERY, &t) + e = OpenProcessToken(p, TOKEN_QUERY|TOKEN_DUPLICATE, &t) if e != nil { return 0, e } @@ -785,8 +787,8 @@ func (token Token) GetLinkedToken() (Token, error) { return linkedToken, nil } -// GetSystemDirectory retrieves path to current location of the system -// directory, which is typically, though not always, C:\Windows\System32. +// GetSystemDirectory retrieves the path to current location of the system +// directory, which is typically, though not always, `C:\Windows\System32`. func GetSystemDirectory() (string, error) { n := uint32(MAX_PATH) for { @@ -802,6 +804,42 @@ func GetSystemDirectory() (string, error) { } } +// GetWindowsDirectory retrieves the path to current location of the Windows +// directory, which is typically, though not always, `C:\Windows`. This may +// be a private user directory in the case that the application is running +// under a terminal server. +func GetWindowsDirectory() (string, error) { + n := uint32(MAX_PATH) + for { + b := make([]uint16, n) + l, e := getWindowsDirectory(&b[0], n) + if e != nil { + return "", e + } + if l <= n { + return UTF16ToString(b[:l]), nil + } + n = l + } +} + +// GetSystemWindowsDirectory retrieves the path to current location of the +// Windows directory, which is typically, though not always, `C:\Windows`. +func GetSystemWindowsDirectory() (string, error) { + n := uint32(MAX_PATH) + for { + b := make([]uint16, n) + l, e := getSystemWindowsDirectory(&b[0], n) + if e != nil { + return "", e + } + if l <= n { + return UTF16ToString(b[:l]), nil + } + n = l + } +} + // IsMember reports whether the access token t is a member of the provided SID. func (t Token) IsMember(sid *SID) (bool, error) { var b int32 diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index b23050924f..ed36134b25 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -257,6 +257,10 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetEvent(event Handle) (err error) = kernel32.SetEvent //sys ResetEvent(event Handle) (err error) = kernel32.ResetEvent //sys PulseEvent(event Handle) (err error) = kernel32.PulseEvent +//sys CreateMutex(mutexAttrs *SecurityAttributes, initialOwner bool, name *uint16) (handle Handle, err error) = kernel32.CreateMutexW +//sys CreateMutexEx(mutexAttrs *SecurityAttributes, name *uint16, flags uint32, desiredAccess uint32) (handle Handle, err error) = kernel32.CreateMutexExW +//sys OpenMutex(desiredAccess uint32, inheritHandle bool, name *uint16) (handle Handle, err error) = kernel32.OpenMutexW +//sys ReleaseMutex(mutex Handle) (err error) = kernel32.ReleaseMutex //sys SleepEx(milliseconds uint32, alertable bool) (ret uint32) = kernel32.SleepEx //sys CreateJobObject(jobAttr *SecurityAttributes, name *uint16) (handle Handle, err error) = kernel32.CreateJobObjectW //sys AssignProcessToJobObject(job Handle, process Handle) (err error) = kernel32.AssignProcessToJobObject @@ -269,6 +273,7 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys GenerateConsoleCtrlEvent(ctrlEvent uint32, processGroupID uint32) (err error) //sys GetProcessId(process Handle) (id uint32, err error) //sys OpenThread(desiredAccess uint32, inheritHandle bool, threadId uint32) (handle Handle, err error) +//sys SetProcessPriorityBoost(process Handle, disable bool) (err error) = kernel32.SetProcessPriorityBoost // Volume Management Functions //sys DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) = DefineDosDeviceW @@ -291,11 +296,16 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) = SetVolumeLabelW //sys SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) = SetVolumeMountPointW //sys MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret int32, err error) [failretval==0] = user32.MessageBoxW +//sys ExitWindowsEx(flags uint32, reason uint32) (err error) = user32.ExitWindowsEx +//sys InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) = advapi32.InitiateSystemShutdownExW +//sys SetProcessShutdownParameters(level uint32, flags uint32) (err error) = kernel32.SetProcessShutdownParameters +//sys GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) = kernel32.GetProcessShutdownParameters //sys clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) = ole32.CLSIDFromString //sys stringFromGUID2(rguid *GUID, lpsz *uint16, cchMax int32) (chars int32) = ole32.StringFromGUID2 //sys coCreateGuid(pguid *GUID) (ret error) = ole32.CoCreateGuid //sys CoTaskMemFree(address unsafe.Pointer) = ole32.CoTaskMemFree //sys rtlGetVersion(info *OsVersionInfoEx) (ret error) = ntdll.RtlGetVersion +//sys rtlGetNtVersionNumbers(majorVersion *uint32, minorVersion *uint32, buildNumber *uint32) = ntdll.RtlGetNtVersionNumbers // syscall interface implementation for other packages @@ -1306,8 +1316,8 @@ func (t Token) KnownFolderPath(folderID *KNOWNFOLDERID, flags uint32) (string, e return UTF16ToString((*[(1 << 30) - 1]uint16)(unsafe.Pointer(p))[:]), nil } -// RtlGetVersion returns the true version of the underlying operating system, ignoring -// any manifesting or compatibility layers on top of the win32 layer. +// RtlGetVersion returns the version of the underlying operating system, ignoring +// manifest semantics but is affected by the application compatibility layer. func RtlGetVersion() *OsVersionInfoEx { info := &OsVersionInfoEx{} info.osVersionInfoSize = uint32(unsafe.Sizeof(*info)) @@ -1318,3 +1328,11 @@ func RtlGetVersion() *OsVersionInfoEx { _ = rtlGetVersion(info) return info } + +// RtlGetNtVersionNumbers returns the version of the underlying operating system, +// ignoring manifest semantics and the application compatibility layer. +func RtlGetNtVersionNumbers() (majorVersion, minorVersion, buildNumber uint32) { + rtlGetNtVersionNumbers(&majorVersion, &minorVersion, &buildNumber) + buildNumber &= 0xffff + return +} diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index 1e3947f0f6..a9c1c506da 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -1190,6 +1190,28 @@ const ( REG_QWORD = REG_QWORD_LITTLE_ENDIAN ) +const ( + EVENT_MODIFY_STATE = 0x0002 + EVENT_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | SYNCHRONIZE | 0x3 + + MUTANT_QUERY_STATE = 0x0001 + MUTANT_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | SYNCHRONIZE | MUTANT_QUERY_STATE + + SEMAPHORE_MODIFY_STATE = 0x0002 + SEMAPHORE_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | SYNCHRONIZE | 0x3 + + TIMER_QUERY_STATE = 0x0001 + TIMER_MODIFY_STATE = 0x0002 + TIMER_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | SYNCHRONIZE | TIMER_QUERY_STATE | TIMER_MODIFY_STATE + + MUTEX_MODIFY_STATE = MUTANT_QUERY_STATE + MUTEX_ALL_ACCESS = MUTANT_ALL_ACCESS + + CREATE_EVENT_MANUAL_RESET = 0x1 + CREATE_EVENT_INITIAL_SET = 0x2 + CREATE_MUTEX_INITIAL_OWNER = 0x1 +) + type AddrinfoW struct { Flags int32 Family int32 @@ -1666,3 +1688,68 @@ type OsVersionInfoEx struct { ProductType byte _ byte } + +const ( + EWX_LOGOFF = 0x00000000 + EWX_SHUTDOWN = 0x00000001 + EWX_REBOOT = 0x00000002 + EWX_FORCE = 0x00000004 + EWX_POWEROFF = 0x00000008 + EWX_FORCEIFHUNG = 0x00000010 + EWX_QUICKRESOLVE = 0x00000020 + EWX_RESTARTAPPS = 0x00000040 + EWX_HYBRID_SHUTDOWN = 0x00400000 + EWX_BOOTOPTIONS = 0x01000000 + + SHTDN_REASON_FLAG_COMMENT_REQUIRED = 0x01000000 + SHTDN_REASON_FLAG_DIRTY_PROBLEM_ID_REQUIRED = 0x02000000 + SHTDN_REASON_FLAG_CLEAN_UI = 0x04000000 + SHTDN_REASON_FLAG_DIRTY_UI = 0x08000000 + SHTDN_REASON_FLAG_USER_DEFINED = 0x40000000 + SHTDN_REASON_FLAG_PLANNED = 0x80000000 + SHTDN_REASON_MAJOR_OTHER = 0x00000000 + SHTDN_REASON_MAJOR_NONE = 0x00000000 + SHTDN_REASON_MAJOR_HARDWARE = 0x00010000 + SHTDN_REASON_MAJOR_OPERATINGSYSTEM = 0x00020000 + SHTDN_REASON_MAJOR_SOFTWARE = 0x00030000 + SHTDN_REASON_MAJOR_APPLICATION = 0x00040000 + SHTDN_REASON_MAJOR_SYSTEM = 0x00050000 + SHTDN_REASON_MAJOR_POWER = 0x00060000 + SHTDN_REASON_MAJOR_LEGACY_API = 0x00070000 + SHTDN_REASON_MINOR_OTHER = 0x00000000 + SHTDN_REASON_MINOR_NONE = 0x000000ff + SHTDN_REASON_MINOR_MAINTENANCE = 0x00000001 + SHTDN_REASON_MINOR_INSTALLATION = 0x00000002 + SHTDN_REASON_MINOR_UPGRADE = 0x00000003 + SHTDN_REASON_MINOR_RECONFIG = 0x00000004 + SHTDN_REASON_MINOR_HUNG = 0x00000005 + SHTDN_REASON_MINOR_UNSTABLE = 0x00000006 + SHTDN_REASON_MINOR_DISK = 0x00000007 + SHTDN_REASON_MINOR_PROCESSOR = 0x00000008 + SHTDN_REASON_MINOR_NETWORKCARD = 0x00000009 + SHTDN_REASON_MINOR_POWER_SUPPLY = 0x0000000a + SHTDN_REASON_MINOR_CORDUNPLUGGED = 0x0000000b + SHTDN_REASON_MINOR_ENVIRONMENT = 0x0000000c + SHTDN_REASON_MINOR_HARDWARE_DRIVER = 0x0000000d + SHTDN_REASON_MINOR_OTHERDRIVER = 0x0000000e + SHTDN_REASON_MINOR_BLUESCREEN = 0x0000000F + SHTDN_REASON_MINOR_SERVICEPACK = 0x00000010 + SHTDN_REASON_MINOR_HOTFIX = 0x00000011 + SHTDN_REASON_MINOR_SECURITYFIX = 0x00000012 + SHTDN_REASON_MINOR_SECURITY = 0x00000013 + SHTDN_REASON_MINOR_NETWORK_CONNECTIVITY = 0x00000014 + SHTDN_REASON_MINOR_WMI = 0x00000015 + SHTDN_REASON_MINOR_SERVICEPACK_UNINSTALL = 0x00000016 + SHTDN_REASON_MINOR_HOTFIX_UNINSTALL = 0x00000017 + SHTDN_REASON_MINOR_SECURITYFIX_UNINSTALL = 0x00000018 + SHTDN_REASON_MINOR_MMC = 0x00000019 + SHTDN_REASON_MINOR_SYSTEMRESTORE = 0x0000001a + SHTDN_REASON_MINOR_TERMSRV = 0x00000020 + SHTDN_REASON_MINOR_DC_PROMOTION = 0x00000021 + SHTDN_REASON_MINOR_DC_DEMOTION = 0x00000022 + SHTDN_REASON_UNKNOWN = SHTDN_REASON_MINOR_NONE + SHTDN_REASON_LEGACY_API = SHTDN_REASON_MAJOR_LEGACY_API | SHTDN_REASON_FLAG_PLANNED + SHTDN_REASON_VALID_BIT_MASK = 0xc0ffffff + + SHUTDOWN_NORETRY = 0x1 +) diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index d461bed98a..4a9893242e 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -197,6 +197,10 @@ var ( procSetEvent = modkernel32.NewProc("SetEvent") procResetEvent = modkernel32.NewProc("ResetEvent") procPulseEvent = modkernel32.NewProc("PulseEvent") + procCreateMutexW = modkernel32.NewProc("CreateMutexW") + procCreateMutexExW = modkernel32.NewProc("CreateMutexExW") + procOpenMutexW = modkernel32.NewProc("OpenMutexW") + procReleaseMutex = modkernel32.NewProc("ReleaseMutex") procSleepEx = modkernel32.NewProc("SleepEx") procCreateJobObjectW = modkernel32.NewProc("CreateJobObjectW") procAssignProcessToJobObject = modkernel32.NewProc("AssignProcessToJobObject") @@ -209,6 +213,7 @@ var ( procGenerateConsoleCtrlEvent = modkernel32.NewProc("GenerateConsoleCtrlEvent") procGetProcessId = modkernel32.NewProc("GetProcessId") procOpenThread = modkernel32.NewProc("OpenThread") + procSetProcessPriorityBoost = modkernel32.NewProc("SetProcessPriorityBoost") procDefineDosDeviceW = modkernel32.NewProc("DefineDosDeviceW") procDeleteVolumeMountPointW = modkernel32.NewProc("DeleteVolumeMountPointW") procFindFirstVolumeW = modkernel32.NewProc("FindFirstVolumeW") @@ -229,11 +234,16 @@ var ( procSetVolumeLabelW = modkernel32.NewProc("SetVolumeLabelW") procSetVolumeMountPointW = modkernel32.NewProc("SetVolumeMountPointW") procMessageBoxW = moduser32.NewProc("MessageBoxW") + procExitWindowsEx = moduser32.NewProc("ExitWindowsEx") + procInitiateSystemShutdownExW = modadvapi32.NewProc("InitiateSystemShutdownExW") + procSetProcessShutdownParameters = modkernel32.NewProc("SetProcessShutdownParameters") + procGetProcessShutdownParameters = modkernel32.NewProc("GetProcessShutdownParameters") procCLSIDFromString = modole32.NewProc("CLSIDFromString") procStringFromGUID2 = modole32.NewProc("StringFromGUID2") procCoCreateGuid = modole32.NewProc("CoCreateGuid") procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") procRtlGetVersion = modntdll.NewProc("RtlGetVersion") + procRtlGetNtVersionNumbers = modntdll.NewProc("RtlGetNtVersionNumbers") procWSAStartup = modws2_32.NewProc("WSAStartup") procWSACleanup = modws2_32.NewProc("WSACleanup") procWSAIoctl = modws2_32.NewProc("WSAIoctl") @@ -303,6 +313,8 @@ var ( procDuplicateTokenEx = modadvapi32.NewProc("DuplicateTokenEx") procGetUserProfileDirectoryW = moduserenv.NewProc("GetUserProfileDirectoryW") procGetSystemDirectoryW = modkernel32.NewProc("GetSystemDirectoryW") + procGetWindowsDirectoryW = modkernel32.NewProc("GetWindowsDirectoryW") + procGetSystemWindowsDirectoryW = modkernel32.NewProc("GetSystemWindowsDirectoryW") procWTSQueryUserToken = modwtsapi32.NewProc("WTSQueryUserToken") procWTSEnumerateSessionsW = modwtsapi32.NewProc("WTSEnumerateSessionsW") procWTSFreeMemory = modwtsapi32.NewProc("WTSFreeMemory") @@ -2105,6 +2117,69 @@ func PulseEvent(event Handle) (err error) { return } +func CreateMutex(mutexAttrs *SecurityAttributes, initialOwner bool, name *uint16) (handle Handle, err error) { + var _p0 uint32 + if initialOwner { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procCreateMutexW.Addr(), 3, uintptr(unsafe.Pointer(mutexAttrs)), uintptr(_p0), uintptr(unsafe.Pointer(name))) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func CreateMutexEx(mutexAttrs *SecurityAttributes, name *uint16, flags uint32, desiredAccess uint32) (handle Handle, err error) { + r0, _, e1 := syscall.Syscall6(procCreateMutexExW.Addr(), 4, uintptr(unsafe.Pointer(mutexAttrs)), uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(desiredAccess), 0, 0) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func OpenMutex(desiredAccess uint32, inheritHandle bool, name *uint16) (handle Handle, err error) { + var _p0 uint32 + if inheritHandle { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procOpenMutexW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(name))) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func ReleaseMutex(mutex Handle) (err error) { + r1, _, e1 := syscall.Syscall(procReleaseMutex.Addr(), 1, uintptr(mutex), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func SleepEx(milliseconds uint32, alertable bool) (ret uint32) { var _p0 uint32 if alertable { @@ -2255,6 +2330,24 @@ func OpenThread(desiredAccess uint32, inheritHandle bool, threadId uint32) (hand return } +func SetProcessPriorityBoost(process Handle, disable bool) (err error) { + var _p0 uint32 + if disable { + _p0 = 1 + } else { + _p0 = 0 + } + r1, _, e1 := syscall.Syscall(procSetProcessPriorityBoost.Addr(), 2, uintptr(process), uintptr(_p0), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) { r1, _, e1 := syscall.Syscall(procDefineDosDeviceW.Addr(), 3, uintptr(flags), uintptr(unsafe.Pointer(deviceName)), uintptr(unsafe.Pointer(targetPath))) if r1 == 0 { @@ -2495,6 +2588,66 @@ func MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret return } +func ExitWindowsEx(flags uint32, reason uint32) (err error) { + r1, _, e1 := syscall.Syscall(procExitWindowsEx.Addr(), 2, uintptr(flags), uintptr(reason), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) { + var _p0 uint32 + if forceAppsClosed { + _p0 = 1 + } else { + _p0 = 0 + } + var _p1 uint32 + if rebootAfterShutdown { + _p1 = 1 + } else { + _p1 = 0 + } + r1, _, e1 := syscall.Syscall6(procInitiateSystemShutdownExW.Addr(), 6, uintptr(unsafe.Pointer(machineName)), uintptr(unsafe.Pointer(message)), uintptr(timeout), uintptr(_p0), uintptr(_p1), uintptr(reason)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetProcessShutdownParameters(level uint32, flags uint32) (err error) { + r1, _, e1 := syscall.Syscall(procSetProcessShutdownParameters.Addr(), 2, uintptr(level), uintptr(flags), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) { + r1, _, e1 := syscall.Syscall(procGetProcessShutdownParameters.Addr(), 2, uintptr(unsafe.Pointer(level)), uintptr(unsafe.Pointer(flags)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) { r0, _, _ := syscall.Syscall(procCLSIDFromString.Addr(), 2, uintptr(unsafe.Pointer(lpsz)), uintptr(unsafe.Pointer(pclsid)), 0) if r0 != 0 { @@ -2530,6 +2683,11 @@ func rtlGetVersion(info *OsVersionInfoEx) (ret error) { return } +func rtlGetNtVersionNumbers(majorVersion *uint32, minorVersion *uint32, buildNumber *uint32) { + syscall.Syscall(procRtlGetNtVersionNumbers.Addr(), 3, uintptr(unsafe.Pointer(majorVersion)), uintptr(unsafe.Pointer(minorVersion)), uintptr(unsafe.Pointer(buildNumber))) + return +} + func WSAStartup(verreq uint32, data *WSAData) (sockerr error) { r0, _, _ := syscall.Syscall(procWSAStartup.Addr(), 2, uintptr(verreq), uintptr(unsafe.Pointer(data)), 0) if r0 != 0 { @@ -3307,6 +3465,32 @@ func getSystemDirectory(dir *uint16, dirLen uint32) (len uint32, err error) { return } +func getWindowsDirectory(dir *uint16, dirLen uint32) (len uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetWindowsDirectoryW.Addr(), 2, uintptr(unsafe.Pointer(dir)), uintptr(dirLen), 0) + len = uint32(r0) + if len == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getSystemWindowsDirectory(dir *uint16, dirLen uint32) (len uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetSystemWindowsDirectoryW.Addr(), 2, uintptr(unsafe.Pointer(dir)), uintptr(dirLen), 0) + len = uint32(r0) + if len == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func WTSQueryUserToken(session uint32, token *Token) (err error) { r1, _, e1 := syscall.Syscall(procWTSQueryUserToken.Addr(), 2, uintptr(session), uintptr(unsafe.Pointer(token)), 0) if r1 == 0 { diff --git a/vendor/modules.txt b/vendor/modules.txt index 0443dd936e..b495bea50c 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -35,15 +35,14 @@ github.com/GoogleCloudPlatform/k8s-cloud-provider/pkg/cloud/mock github.com/JeffAshton/win_pdh # github.com/MakeNowJust/heredoc v0.0.0-20170808103936-bb23615498cd github.com/MakeNowJust/heredoc -# github.com/Microsoft/go-winio v0.4.14 +# github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 github.com/Microsoft/go-winio github.com/Microsoft/go-winio/pkg/etw github.com/Microsoft/go-winio/pkg/etwlogrus github.com/Microsoft/go-winio/pkg/guid -# github.com/Microsoft/hcsshim v0.8.6 +# github.com/Microsoft/hcsshim v0.8.6 => github.com/Microsoft/hcsshim v0.8.7-0.20190926181021-82c7525d98c8 github.com/Microsoft/hcsshim github.com/Microsoft/hcsshim/hcn -github.com/Microsoft/hcsshim/internal/guid github.com/Microsoft/hcsshim/internal/hcs github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns @@ -54,9 +53,13 @@ github.com/Microsoft/hcsshim/internal/cni github.com/Microsoft/hcsshim/internal/interop github.com/Microsoft/hcsshim/internal/regstate github.com/Microsoft/hcsshim/internal/runhcs -github.com/Microsoft/hcsshim/internal/guestrequest +github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options +github.com/Microsoft/hcsshim/internal/cow +github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields +github.com/Microsoft/hcsshim/internal/oc github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/schema2 github.com/Microsoft/hcsshim/internal/longpath github.com/Microsoft/hcsshim/internal/safefile @@ -148,9 +151,9 @@ github.com/cloudflare/cfssl/info github.com/container-storage-interface/spec/lib/go/csi # github.com/containerd/cgroups v0.0.0-20190923161937-abd0b19954a6 => github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601 github.com/containerd/cgroups -# github.com/containerd/console v0.0.0-20170925154832-84eeaae905fa => github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50 +# github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 => github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50 github.com/containerd/console -# github.com/containerd/containerd v1.2.8 => github.com/rancher/containerd v1.3.0-k3s.1 +# github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 => github.com/rancher/containerd v1.3.0-k3s.1 github.com/containerd/containerd/cmd/containerd-shim-runc-v1 github.com/containerd/containerd github.com/containerd/containerd/namespaces @@ -841,7 +844,7 @@ github.com/spf13/afero/mem github.com/spf13/cobra # github.com/spf13/pflag v1.0.3 github.com/spf13/pflag -# github.com/syndtr/gocapability v0.0.0-20160928074757-e7cb7fa329f4 +# github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 github.com/syndtr/gocapability/capability # github.com/tchap/go-patricia v2.3.0+incompatible github.com/tchap/go-patricia/patricia @@ -883,23 +886,23 @@ github.com/vmware/govmomi/sts/internal github.com/vmware/govmomi/lookup/methods # go.etcd.io/bbolt v1.3.3 go.etcd.io/bbolt -# go.opencensus.io v0.21.0 +# go.opencensus.io v0.22.0 +go.opencensus.io/trace +go.opencensus.io/internal +go.opencensus.io/trace/internal +go.opencensus.io/trace/tracestate +go.opencensus.io go.opencensus.io/plugin/ochttp go.opencensus.io/plugin/ochttp/propagation/b3 go.opencensus.io/stats go.opencensus.io/stats/view go.opencensus.io/tag -go.opencensus.io/trace go.opencensus.io/trace/propagation go.opencensus.io/metric/metricdata go.opencensus.io/stats/internal go.opencensus.io/internal/tagencoding go.opencensus.io/metric/metricproducer -go.opencensus.io/internal -go.opencensus.io/trace/internal -go.opencensus.io/trace/tracestate go.opencensus.io/resource -go.opencensus.io # go.uber.org/atomic v0.0.0-20181018215023-8dc6146f7569 go.uber.org/atomic # go.uber.org/multierr v0.0.0-20180122172545-ddea229ff1df @@ -956,7 +959,7 @@ golang.org/x/oauth2/jwt # golang.org/x/sync v0.0.0-20190423024810-112230192c58 golang.org/x/sync/errgroup golang.org/x/sync/semaphore -# golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e +# golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 golang.org/x/sys/unix golang.org/x/sys/windows golang.org/x/sys/windows/svc